Benzyloxycarbonyl-N-alpha-Methyl-L-leucine
Z-N-methyl-L-leucine
CAS: 33099-08-0
Molecular Formula: C15H21NO4
Benzyloxycarbonyl-N-alpha-Methyl-L-leucine - Names and Identifiers
| Name | Z-N-methyl-L-leucine |
| Synonyms | Z-N-Me-Leu-OH Z-N-Me-L-Leu-OH Cbz-N-Me-L-Leu-OH Z-N-methyl-L-leucine Cbz-N-Methyl-L-leucine Cbz-N-methyl-L-leucine N-cbz-N-methyl-L-leucine N-carbobenzyloxy-N-methyl-L-leucine N-[(benzyloxy)carbonyl]-N-methyl-L-leucine Benzyloxycarbonyl-N-alpha-Methyl-L-leucine 4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid (S)-2-((benzyloxycarbonyl)(methyl)amino)-4-methylpentanoic acid (2S)-2-[[(benzyloxy)carbonyl](Methyl)aMino]-4-Methylpentanoic acid |
| CAS | 33099-08-0 |
| InChI | InChI=1/C15H21NO4/c1-11(2)9-13(14(17)18)16(3)15(19)20-10-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3,(H,17,18)/t13-/m0/s1 |
Benzyloxycarbonyl-N-alpha-Methyl-L-leucine - Physico-chemical Properties
| Molecular Formula | C15H21NO4 |
| Molar Mass | 279.33 |
| Density | 1.145±0.06 g/cm3(Predicted) |
| Melting Point | 74-75 °C |
| Boling Point | 419.4±34.0 °C(Predicted) |
| Flash Point | 207.5°C |
| Vapor Presure | 8.72E-08mmHg at 25°C |
| BRN | 1993458 |
| pKa | 4.02±0.21(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.528 |
Benzyloxycarbonyl-N-alpha-Methyl-L-leucine - Risk and Safety
| WGK Germany | 3 |
Benzyloxycarbonyl-N-alpha-Methyl-L-leucine - Introduction
Z-N-methyl-L-leucine(Z-N-methyl-L-leucine) is an organic compound. The following is its nature, use, preparation and safety information:
Nature:
1. appearance: usually white crystalline powder.
2. solubility: can be dissolved in some organic solvents, such as ethanol and dichloromethane.
3. Chemical properties: As an amino acid derivative, it has typical amino acid properties, is alkaline, and can react with acid and base under acidic conditions.
Use:
1. Biochemistry research: As one of the reagents for studying and analyzing amino acid metabolism and protein folding.
2. drug synthesis: Z-N-methyl-L-leucine is used as an intermediate in the synthesis of some drugs.
Preparation Method:
Z-N-methyl-L-leucine can be prepared by chemical synthesis, and can be prepared in the laboratory by the following steps: first, N-benzyl-L-leucine reacts with methyl iodide for methylation, and then the resulting product is purified and crystallized to obtain the target compound.
Safety Information:
1. The safety information of the Z-N-methyl-L-leucine is limited, so it is necessary to comply with the safety operation procedures of the laboratory when using it.
2. During operation, direct contact with skin and eyes should be avoided to prevent irritation or damage.
3. When it needs to be handled or stored, it should be stored in a sealed container and kept away from heat and fire sources.
Nature:
1. appearance: usually white crystalline powder.
2. solubility: can be dissolved in some organic solvents, such as ethanol and dichloromethane.
3. Chemical properties: As an amino acid derivative, it has typical amino acid properties, is alkaline, and can react with acid and base under acidic conditions.
Use:
1. Biochemistry research: As one of the reagents for studying and analyzing amino acid metabolism and protein folding.
2. drug synthesis: Z-N-methyl-L-leucine is used as an intermediate in the synthesis of some drugs.
Preparation Method:
Z-N-methyl-L-leucine can be prepared by chemical synthesis, and can be prepared in the laboratory by the following steps: first, N-benzyl-L-leucine reacts with methyl iodide for methylation, and then the resulting product is purified and crystallized to obtain the target compound.
Safety Information:
1. The safety information of the Z-N-methyl-L-leucine is limited, so it is necessary to comply with the safety operation procedures of the laboratory when using it.
2. During operation, direct contact with skin and eyes should be avoided to prevent irritation or damage.
3. When it needs to be handled or stored, it should be stored in a sealed container and kept away from heat and fire sources.
Last Update：2024-04-09 20:49:11
Supplier List
Product Name: Cbz-N-Me-Leu-OH Visit Supplier Webpage Request for quotation
CAS: 33099-08-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33099-08-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Cbz-N-Me-Leu-OH Visit Supplier Webpage Request for quotation
CAS: 33099-08-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33099-08-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History