Name | Tilorone |
Synonyms | 2 [WLN] Tilorone 27591-97-5 2,TILORONE Bis-DEAE-fluorenone 2,7-Bis[2-(diethylamino)ethoxy]-9-fluorenone 2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one 2,7-Bis[2-(diethylamino)ethoxy]-9H-fluoren-9-on 2,7-Bis[2-(diethylamino)ethoxy]-9H-fluoren-9-one 9H-fluoren-9-one, 2,7-bis[2-(diethylamino)ethoxy]- 9H-Fluoren-9-one, 2,7-bis[2-(diethylamino)ethoxy]- |
CAS | 27591-97-5 |
EINECS | 1806241-263-5 |
InChI | InChI=1/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 |
Molecular Formula | C25H34N2O3 |
Molar Mass | 410.55 |
Density | 1.102±0.06 g/cm3(Predicted) |
Boling Point | 552.3±50.0 °C(Predicted) |
Flash Point | 287.8°C |
Vapor Presure | 3.05E-12mmHg at 25°C |
pKa | 9.67±0.25(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | 1.563 |
introduction | telolone is a derivative of diethylaminofluorenone, which can effectively induce interferon and produce a wide range of pharmacological activities, and has a wide range of application prospects. |
indications | tilolone has obvious curative effect on viral skin diseases, such as herpes zoster and molluscum contagiosum, and can also be used to resist tumors such as black pigment tumors. |
Uses | Tilorone is a broad-spectrum small molecule interferon inducer, which can enhance the body's humoral immunity, significantly increase the production of IgM, IgG, and IgE, and can strengthen the phagocytic function of the reticuloendothelial system and inhibit a variety of viral infections. |
side effects | large doses have drowsiness, nausea, abdominal pain, diarrhea, dizziness, fatigue, insomnia and other reactions. long-term use of can cause corneal epithelial edema and chronic infiltration, and large doses have certain toxicity to the heart. |