Chloronitroanisole
2-chloro-4-nitroanisole
CAS: 4920-79-0
Molecular Formula: C7H6ClNO3
Chloronitroanisole - Names and Identifiers
| Name | 2-chloro-4-nitroanisole |
| Synonyms | Chloronitroanisole Chloronitoranisole 2-Chloro-4-nitoranisole 2-chloro-4-nitoranisole 2-chloro-4-nitroanisole 2-chloro-4-nitro-anisol 2-CHLORO-4-NITROANISOLE Anisole, 2-chloro-4-nitro- 3-CHLORO-4-METHOXYNITROBENZENE 2-chloro-1-methoxy-4-nitrobenzene 2-CHLORO-1-METHOXY-4-NITROBENZENE 2-chloro-1-methoxy-4-nitro-benzen |
| CAS | 4920-79-0 |
| EINECS | 225-547-4 |
| InChI | InChI=1/C7H6ClNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
Chloronitroanisole - Physico-chemical Properties
| Molecular Formula | C7H6ClNO3 |
| Molar Mass | 187.58 |
| Density | 1.366±0.06 g/cm3(Predicted) |
| Melting Point | 94 °C |
| Boling Point | 286.6±20.0 °C(Predicted) |
| Flash Point | 127.1°C |
| Vapor Presure | 0.00451mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.559 |
| Use | Used as a pharmaceutical Intermediate |
Chloronitroanisole - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| RTECS | BZ8578000 |
| Hazard Class | IRRITANT |
Chloronitroanisole - Reference Information
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| Use | Used as a pharmaceutical intermediate |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 1180 mg/kg; Oral-mouse LD50: 1550 mg/kg |
| stimulation data | skin-rabbit 500 mg/24 hours mild; Eye-rabbit 100 mg mild |
| flammability hazard characteristics | combustible, decomposition of toxic chlorides during combustion, nitrogen oxide gas |
| storage and transportation characteristics | warehouse low temperature, ventilation, drying |
| fire extinguishing agent | water, carbon dioxide, dry powder, sand |
Last Update：2024-04-09 15:16:46
