D-3-METHYLPHENYLALANINE
D-3-Methylphe
CAS: 114926-39-5
Molecular Formula: C10H13NO2
D-3-METHYLPHENYLALANINE - Names and Identifiers
| Name | D-3-Methylphe |
| Synonyms | D-3-METHYLPHE D-3-Methylphe H-M-ME-D-PHE-OH H-D-PHE(3-ME)-OH RARECHEM BK PT 0064 3-Methy-D-Phenylalanine D-3-Methylphenylalanine D-3-METHYLPHENYLALANINE 3-Methylphenyl-D-Alanine 3-Methyl-D-phenylalanine 3-METHYL-D-PHENYLALANINE (R)-2-AMINO-3-M-TOLYL-PROPIONIC ACID (2R)-2-ammonio-3-(2-methylphenyl)propanoate |
| CAS | 114926-39-5 |
| EINECS | 145-896-5 |
| InChI | InChI=1/C10H13NO2/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1 |
D-3-METHYLPHENYLALANINE - Physico-chemical Properties
| Molecular Formula | C10H13NO2 |
| Molar Mass | 179.22 |
| Density | 1.165±0.06 g/cm3(Predicted) |
| Boling Point | 322.8±30.0 °C(Predicted) |
| Flash Point | 151.1°C |
| Vapor Presure | 8.9E-05mmHg at 25°C |
| pKa | 2.22±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,2-8°C |
| Refractive Index | 1.568 |
D-3-METHYLPHENYLALANINE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
D-3-METHYLPHENYLALANINE - Introduction
3-Methyl-D-phenylalanine (3-Methyl-D-phenylalanine) is a derivative of an amino acid.
Nature:
1. chemical formula: C11H15NO2.
2. appearance: white crystalline powder.
3. Solubility: Soluble in water and some organic solvents.
4. melting point: about 215-218 ℃.
5. It is an optical isomer and has a D configuration.
Use:
1. 3-Methyl-D-phenylalanine is an important raw material in the synthesis of drugs and pharmaceutical research, especially for the synthesis of chiral drugs.
2. It can also be used to synthesize other biologically active compounds.
Method:
The synthesis of 3-methyl-D-phenylalanine is usually carried out by the following steps:
1. first, the ketone chemical reaction of phenylacetone was carried out to synthesize the corresponding ketone compounds.
2. The ketone compound is reacted with methyl magnesium bromide to form a methyl compound.
3. Finally, the methyl compound was synthesized and converted into 3-methyl-D-phenylalanine.
Safety Information:
The specific safety information of 1. 3-Methyl-D-phenylalanine needs to be evaluated according to its specific use and preparation method.
2. in the process of handling and use, should follow the relevant chemical safety procedures and personal protective measures, such as wearing gloves, goggles and protective clothing.
3. avoid contact with skin and eyes, avoid inhalation or ingestion. In case of accidental contact or inhalation, appropriate first aid treatment should be carried out immediately and medical attention should be sought as needed.
Nature:
1. chemical formula: C11H15NO2.
2. appearance: white crystalline powder.
3. Solubility: Soluble in water and some organic solvents.
4. melting point: about 215-218 ℃.
5. It is an optical isomer and has a D configuration.
Use:
1. 3-Methyl-D-phenylalanine is an important raw material in the synthesis of drugs and pharmaceutical research, especially for the synthesis of chiral drugs.
2. It can also be used to synthesize other biologically active compounds.
Method:
The synthesis of 3-methyl-D-phenylalanine is usually carried out by the following steps:
1. first, the ketone chemical reaction of phenylacetone was carried out to synthesize the corresponding ketone compounds.
2. The ketone compound is reacted with methyl magnesium bromide to form a methyl compound.
3. Finally, the methyl compound was synthesized and converted into 3-methyl-D-phenylalanine.
Safety Information:
The specific safety information of 1. 3-Methyl-D-phenylalanine needs to be evaluated according to its specific use and preparation method.
2. in the process of handling and use, should follow the relevant chemical safety procedures and personal protective measures, such as wearing gloves, goggles and protective clothing.
3. avoid contact with skin and eyes, avoid inhalation or ingestion. In case of accidental contact or inhalation, appropriate first aid treatment should be carried out immediately and medical attention should be sought as needed.
Last Update：2024-04-09 02:00:41
