D-3-Nitrophenylalanine
D-3-Nitrophe
CAS: 169530-97-6
Molecular Formula: C9H10N2O4
D-3-Nitrophenylalanine - Names and Identifiers
| Name | D-3-Nitrophe |
| Synonyms | D-3-NITROPHE D-3-Nitrophe D-3-NO2-Phe-OH H-D-PHE(3-NO2)-OH D-3-Nitrophenylalanine D-3-NITROPHENYLALANINE 3-Nitro-D-phenylalanine (2R)-2-ammonio-3-(3-nitrophenyl)propanoate (R)-2-amino-3-(3-nitrophenyl)propanoic acid D-2-AMINO-3-(3-NITRO PHENYL)-PROPIONIC ACID (2R)-2-amino-3-(3-nitrophenyl)propanoic acid |
| CAS | 169530-97-6 |
| EINECS | 145-896-5 |
| InChI | InChI=1/C9H10N2O4/c10-8(9(12)13)5-6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m1/s1 |
D-3-Nitrophenylalanine - Physico-chemical Properties
| Molecular Formula | C9H10N2O4 |
| Molar Mass | 210.19 |
| Density | 1.408±0.06 g/cm3(Predicted) |
| Boling Point | 410.8±35.0 °C(Predicted) |
| Flash Point | 202.3°C |
| Vapor Presure | 1.74E-07mmHg at 25°C |
| Appearance | Solid |
| Color | Off-white to pale yellow |
| pKa | 2.12±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.614 |
D-3-Nitrophenylalanine - Risk and Safety
| Hazard Symbols | Xi - Irritant |
D-3-Nitrophenylalanine - Introduction
D-3-Nitrophe(3-Nitro-D-phenylalanine) is an organic compound with the chemical formula C9H10N2O4. Its main properties are as follows:
Nature:
1. Appearance: colorless or light yellow crystal or powder.
2. Melting point: about 160-162 degrees Celsius.
3. Solubility: insoluble in water, soluble in acid, alkali and organic solvents.
Use:
D-3-Nitrophe can be used to synthesize peptides, proteins and drug molecules. It has important applications in biomedical research, and can be used to study the properties of protein folding, positioning and interaction.
Method:
The synthesis of D-3-Nitrophe is usually achieved by nucleophilic substitution reactions. A common method is the reaction of 3-nitroacetone with D-phenylalanine under basic conditions to produce the desired product.
Safety Information:
1. D-3-Nitrophe belong to chemicals, should pay attention to the correct operation method and personal protective measures.
2. It may cause irritation to the eyes, skin and respiratory system, should avoid contact.
3. In use or handling, should avoid inhalation of dust or vapor.
4. It is necessary to operate in a well-ventilated environment and wear appropriate protective equipment, such as gloves, glasses and protective clothing.
5. The D-3-Nitrophe should be stored in a closed container, away from fire sources and flammable substances.
Nature:
1. Appearance: colorless or light yellow crystal or powder.
2. Melting point: about 160-162 degrees Celsius.
3. Solubility: insoluble in water, soluble in acid, alkali and organic solvents.
Use:
D-3-Nitrophe can be used to synthesize peptides, proteins and drug molecules. It has important applications in biomedical research, and can be used to study the properties of protein folding, positioning and interaction.
Method:
The synthesis of D-3-Nitrophe is usually achieved by nucleophilic substitution reactions. A common method is the reaction of 3-nitroacetone with D-phenylalanine under basic conditions to produce the desired product.
Safety Information:
1. D-3-Nitrophe belong to chemicals, should pay attention to the correct operation method and personal protective measures.
2. It may cause irritation to the eyes, skin and respiratory system, should avoid contact.
3. In use or handling, should avoid inhalation of dust or vapor.
4. It is necessary to operate in a well-ventilated environment and wear appropriate protective equipment, such as gloves, glasses and protective clothing.
5. The D-3-Nitrophe should be stored in a closed container, away from fire sources and flammable substances.
Last Update：2024-04-09 02:00:43
