DI(BUTAN-3-ONE-1-YL)SULPHIDE
2-Butanone, 4,4'-thiobis-
CAS: 40790-04-3
Molecular Formula: C8H14O2S
DI(BUTAN-3-ONE-1-YL)SULPHIDE - Names and Identifiers
| Name | 2-Butanone, 4,4'-thiobis- |
| Synonyms | NSC 42865 FEMA No. 3335 5-Thianona-2,8-dione 4,4'-Thiodi(2-butanone) 2-Butanone, 4,4'-thiodi- 2-Butanone, 4,4-thiobis- 4,4'-Thiobis(2-butanone) 2-Butanone, 4,4'-thiobis- Di(butan-3-one-1-y1)sulfide DI(BUTAN-3-ONE-1-YL) SULFIDE DI(BUTAN-3-ONE-1-YL)SULPHIDE Di(butan-3-one-1-yl) sulfide 4,4'-sulfanediyldibutan-2-one 4-(3-oxobutylthio)-2-butanone |
| CAS | 40790-04-3 |
| InChI | InChI=1/C8H14O2S/c1-7(9)3-5-11-6-4-8(2)10/h3-6H2,1-2H3 |
DI(BUTAN-3-ONE-1-YL)SULPHIDE - Physico-chemical Properties
| Molecular Formula | C8H14O2S |
| Molar Mass | 174.26 |
| Density | 1.032g/cm3 |
| Boling Point | 288.6°C at 760 mmHg |
| Flash Point | 121.3°C |
| JECFA Number | 502 |
| Vapor Presure | 0.00231mmHg at 25°C |
| Refractive Index | 1.47 |
| Physical and Chemical Properties | Boiling point 95 C (1.3). |
DI(BUTAN-3-ONE-1-YL)SULPHIDE - Reference Information
| FEMA | 3335 | DI(BUTAN-3-ONE-1-YL) SULFIDE |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA(mg/kg): beverages, cold drinks, 1.0; Candy, baked goods, gelatin jelly, pudding, 2.0; Other 1.0. |
| use | food spices. |
Last Update：2024-04-09 19:05:09
