DIMETHYLPHENETHYLSILANE
dimethylphenethylsilane
CAS: 17873-13-1
Molecular Formula: C10H16Si
DIMETHYLPHENETHYLSILANE - Names and Identifiers
| Name | dimethylphenethylsilane |
| Synonyms | dimethylphenethylsilane DIMETHYLPHENETHYLSILANE Benzene, [2-(dimethylsilyl)ethyl]- |
| CAS | 17873-13-1 |
| InChI | InChI=1/C10H16Si/c1-11(2)9-8-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
DIMETHYLPHENETHYLSILANE - Physico-chemical Properties
| Molecular Formula | C10H16Si |
| Molar Mass | 164.32 |
| Density | 0.869g/mLat 25°C(lit.) |
| Boling Point | 83°C/11mmHg(lit.) |
| Flash Point | 70°C |
| Vapor Presure | 0.57mmHg at 25°C |
| Refractive Index | n20/D 1.494(lit.) |
DIMETHYLPHENETHYLSILANE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
DIMETHYLPHENETHYLSILANE - Introduction
The chemical structure of dimethylphenylsilane is (CH3)2(CH3CH2)SiH(CH2)C6H5, which is an organosilicon compound. The following is a description of the nature, use, preparation and safety information of dimethylphenylsilane:
Nature:
1. Appearance: colorless liquid;
2. Molecular weight: 164.3g/mol;
3. Density: 0.855g/cm³;
4. Melting Point:-79 ° C;
5. Boiling point: ~ 119 ° C;
6. Relative vapor density (Air = 1):5.6;
7. Saturated vapor pressure: 18 mmHg,20 ° C;
8. Solubility: Soluble in organic solvents;
9. Stability: stable, but may produce flammable hydrogen at high temperatures.
Use:
1. Dimethylphenylsilane can be used as a reagent and catalyst in organic synthesis;
2. It is used as a crosslinking agent in the modified polymer to enhance the physical and chemical properties of the material;
3. It is used as a coating agent and an anti-reflection agent in the optical field.
Method:
The preparation method of dimethylphenylsilane can be obtained by reacting silane with styrene. The specific preparation route can be achieved through the following steps:
1. Reacting styrene with dimethylchlorosilane to generate dimethylphenethylchlorosilane;
2. Reducing dimethylphenethylchlorosilane with hydrogen to obtain dimethylphenylsilane.
Safety Information:
1. Dimethylphenylsilane is flammable and should be kept away from fire and high temperature areas;
2. When handling and using, wear protective gloves and goggles to ensure adequate ventilation;
3. Avoid contact with strong oxidant to prevent dangerous reaction;
4. If accidental leakage, it should be removed immediately to avoid contact with air and water;
5. Store dimethylphenethylsilane in a cool, dry place to avoid prolonged exposure to the sun.
Nature:
1. Appearance: colorless liquid;
2. Molecular weight: 164.3g/mol;
3. Density: 0.855g/cm³;
4. Melting Point:-79 ° C;
5. Boiling point: ~ 119 ° C;
6. Relative vapor density (Air = 1):5.6;
7. Saturated vapor pressure: 18 mmHg,20 ° C;
8. Solubility: Soluble in organic solvents;
9. Stability: stable, but may produce flammable hydrogen at high temperatures.
Use:
1. Dimethylphenylsilane can be used as a reagent and catalyst in organic synthesis;
2. It is used as a crosslinking agent in the modified polymer to enhance the physical and chemical properties of the material;
3. It is used as a coating agent and an anti-reflection agent in the optical field.
Method:
The preparation method of dimethylphenylsilane can be obtained by reacting silane with styrene. The specific preparation route can be achieved through the following steps:
1. Reacting styrene with dimethylchlorosilane to generate dimethylphenethylchlorosilane;
2. Reducing dimethylphenethylchlorosilane with hydrogen to obtain dimethylphenylsilane.
Safety Information:
1. Dimethylphenylsilane is flammable and should be kept away from fire and high temperature areas;
2. When handling and using, wear protective gloves and goggles to ensure adequate ventilation;
3. Avoid contact with strong oxidant to prevent dangerous reaction;
4. If accidental leakage, it should be removed immediately to avoid contact with air and water;
5. Store dimethylphenethylsilane in a cool, dry place to avoid prolonged exposure to the sun.
Last Update：2024-04-09 02:00:43
