DL-2-TYROSINE - Names and Identifiers
Name | dl-O-tyrosine
|
Synonyms | D, L-O-TYR dl-O-tyrosine DL-O-TYROSINE DL-2-TYROSINE 2-hydroxyphenylalanine 3-(o-hydroxyphenyl)-alanindl DL-3-(2-HYDROXYPHENYL)ALANINE 3-(2-HYDROXYPHENYL)-DL-ALANINE 2-AMINO-3-(2-HYDROXYPHENYL)PROPIONIC ACID 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt)
|
CAS | 2370-61-8
|
EINECS | 219-134-8 |
InChI | InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
DL-2-TYROSINE - Physico-chemical Properties
Molecular Formula | C9H11NO3
|
Molar Mass | 181.19 |
Density | 1.333 |
Melting Point | ~260°C (dec.) |
Boling Point | 369℃ |
Flash Point | 177℃ |
Water Solubility | Soluble in water, and DMSO (Heated). |
Solubility | Aqueous Acid (Sparingly, Sonicated), Aqueous Base (Slightly), DMSO (Slightly, He |
Vapor Presure | 5.14E-18mmHg at 25°C |
Appearance | Powder |
Color | White to Light Grey |
BRN | 2805789 |
pKa | 2.31±0.10(Predicted) |
Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
MDL | MFCD00021725 |
DL-2-TYROSINE - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
WGK Germany | 3 |
RTECS | YP2285000 |
DL-2-TYROSINE - Introduction
dl-O-tyrosine(dl-O-tyrosine) is a synthetic amino acid with the chemical formula C9H11NO3. It is derived from the substitution of a hydrogen atom in the structure of tyrosine.
dl-O-tyrosine have the following properties:
1. Appearance: The dl-O-tyrosine is white crystalline powder.
2. Stability: It is stable at room temperature, but may decompose in the presence of high temperature, light and oxidants.
3. Solubility: dl-O-tyrosine soluble in water and acid, insoluble in organic solvents.
dl-O-tyrosine are widely used in the food and pharmaceutical industries, the specific uses are as follows:
1. Food additives: dl-O-tyrosine can be used as food flavoring agent, enhance the flavor and taste of food.
2. Drug research: dl-O-tyrosine is often used as a precursor for synthetic drugs and is used to produce some important drug substances.
3. Nutritional supplements: dl-O-tyrosine can also be used as a tyrosine supplement in the body to improve physical strength and regulate nerve function.
The preparation of dl-O-tyrosine can be achieved by synthetic chemical methods:
1. Amino acid synthesis: tyrosine can be reacted with appropriate reagents to replace a hydrogen atom in the amino acid molecule to generate dl-O-tyrosine.
2. Synthetic route: The specific synthetic route includes a multi-step organic synthesis reaction, which requires suitable catalysts and reagents.
Safety information about dl-O-tyrosine:
1. Stable nature, only in the presence of high temperature, light and oxidant will have the risk of decomposition.
2. dl-O-tyrosine used in food generally meet safety standards, but still need to follow the appropriate dosage.
3. For people with allergies or special health problems, it is recommended to consult a doctor or professional before use.
Generally speaking, dl-O-tyrosine is a chemical substance that can be used in the food and pharmaceutical industries, with a wide range of applications and a certain degree of safety.
Last Update:2024-04-09 21:54:55