Name | 2-methyldecanenitrile |
Synonyms | FRUTONILE 2-Cyanodecane 2-Methyldecannitril 2-methyl-decanenitril 2-Methyldecanenitrile 2-METHYLDECANONITRILE 2-methyldecanonitrile 2-methyldecanenitrile 2-methyl-Decanenitrile Decanenitrile,2-methyl- |
CAS | 69300-15-8 |
EINECS | 273-960-3 |
InChI | InChI=1/C11H21N/c1-3-4-5-6-7-8-9-11(2)10-12/h11H,3-9H2,1-2H3 |
Molecular Formula | C11H21N |
Molar Mass | 167.29 |
Density | 0.820 |
Boling Point | 251℃ |
Flash Point | 129℃ |
Solubility | Dichloromethane, Hexanes |
Vapor Presure | 2.3Pa at 20℃ |
Appearance | Liquid |
Refractive Index | 1.432 |
LogP | 4.2 at 35℃ and pH7 |
surface tension | 68.4mN/m at 3.5mg/L and 20 ℃ |
EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |