DibroMo-3-hexylthioph
2,5-dibromo-3-hexylthiophene
CAS: 116971-11-0
Molecular Formula: C10H14Br2S
DibroMo-3-hexylthioph - Names and Identifiers
| Name | 2,5-dibromo-3-hexylthiophene |
| Synonyms | M8061 2,5-Dibromo-3-hexylt DibroMo-3-hexylthioph 2,5-dibromo-3-hexylthiophene 2,5-DIBROMO-3-HEXYLTHIOPHENE Thiophene,2,5-dibroMo-3-hexyl- Thiophene, 2,5-dibromo-3-hexyl- |
| CAS | 116971-11-0 |
| EINECS | 639-833-5 |
| InChI | InChI=1/C10H14Br2S/c1-2-3-4-5-6-8-7-9(11)13-10(8)12/h7H,2-6H2,1H3 |
DibroMo-3-hexylthioph - Physico-chemical Properties
| Molecular Formula | C10H14Br2S |
| Molar Mass | 326.09 |
| Density | 1.521 g/mL at 25 °C (lit.) |
| Boling Point | 317.2±37.0 °C(Predicted) |
| Flash Point | >230°F |
| Vapor Presure | 0.000726mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Yellow |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.557(lit.) |
DibroMo-3-hexylthioph - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29339900 |
DibroMo-3-hexylthioph - Reference Information
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | conductive polymer precursor. |
Last Update：2024-04-10 22:29:15
