Eu(ba)3(phen)
TRIS(BENZOYLACETONATO) MONO
CAS: 18130-95-5
Molecular Formula: C30H27EuO6.C12H8N2
Eu(ba)3(phen) - Names and Identifiers
| Name | TRIS(BENZOYLACETONATO) MONO |
| Synonyms | Eu(ba)3(phen) TRIS(BENZOYLACETONATO) MONO |
| CAS | 18130-95-5 |
| InChI | InChI=1/C12H8N2.3C10H10O2.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*1-8(11)7-10(12)9-5-3-2-4-6-9;/h1-8H;3*2-7,11H,1H3;/q;;;;+3/p-3/b;2*8-7+;8-7- |
Eu(ba)3(phen) - Physico-chemical Properties
| Molecular Formula | C30H27EuO6.C12H8N2 |
| Molar Mass | 815.706 |
| Melting Point | 179-186 °C (lit.) |
| Physical and Chemical Properties | WGK Germany:3 |
Eu(ba)3(phen) - Risk and Safety
| WGK Germany | 3 |
Eu(ba)3(phen) - Introduction
TRIS(BENZOYLACETONATO) MONO is an organometallic complex with the chemical formula [Ba(Haacac)(tpy)]Eu(III).
Nature:
-Appearance: TRIS(BENZOYLACETONATO) MONO is a powdery solid.
-Solubility: It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol (MeOH), but insoluble in water.
-Luminescence properties: The complex has remarkable luminescence properties and can emit red fluorescence.
Use:
-Luminescent material: It can be used as a new type of luminescent material for organic electroluminescent diodes (OLEDs), organic solar cells, etc.
-Biomarker: Due to its luminescent properties and stability, it can also be used as a biomarker in bioimaging and bioanalysis applications.
Method:
The preparation of TRIS(BENZOYLACETONATO) MONO usually requires the following steps:
1. Benzoylpyruvic acid was obtained by reacting benzophenone with pyruvic acid.
2. Reaction of benzoylpyruvate with a ferrous reagent (phenanthroline) yields Tris (benzoylpyruvate) mono (ferrous reagent (phenanthroline)) iron (III).
3. Tris (benzoylacetonate) mono (ferrous reagent (phenanthroline)) iron (III) is reacted with Europium (III) salt to obtain the desired target compound.
Safety Information:
This compound is generally a chemical under normal operating conditions and needs to follow laboratory safety procedures. Wear suitable protective equipment during handling to avoid inhalation and contact. Should be stored in a dry, cool place, avoid contact with oxygen and water. Specific safety information should refer to the safety data sheet of the relevant chemical and the instructions provided by the supplier.
Nature:
-Appearance: TRIS(BENZOYLACETONATO) MONO is a powdery solid.
-Solubility: It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol (MeOH), but insoluble in water.
-Luminescence properties: The complex has remarkable luminescence properties and can emit red fluorescence.
Use:
-Luminescent material: It can be used as a new type of luminescent material for organic electroluminescent diodes (OLEDs), organic solar cells, etc.
-Biomarker: Due to its luminescent properties and stability, it can also be used as a biomarker in bioimaging and bioanalysis applications.
Method:
The preparation of TRIS(BENZOYLACETONATO) MONO usually requires the following steps:
1. Benzoylpyruvic acid was obtained by reacting benzophenone with pyruvic acid.
2. Reaction of benzoylpyruvate with a ferrous reagent (phenanthroline) yields Tris (benzoylpyruvate) mono (ferrous reagent (phenanthroline)) iron (III).
3. Tris (benzoylacetonate) mono (ferrous reagent (phenanthroline)) iron (III) is reacted with Europium (III) salt to obtain the desired target compound.
Safety Information:
This compound is generally a chemical under normal operating conditions and needs to follow laboratory safety procedures. Wear suitable protective equipment during handling to avoid inhalation and contact. Should be stored in a dry, cool place, avoid contact with oxygen and water. Specific safety information should refer to the safety data sheet of the relevant chemical and the instructions provided by the supplier.
Last Update：2024-04-10 22:29:15
