FMOC-D-LYS(Z)-OH - Names and Identifiers
Name | Fmoc-D-Lys(Z)-OH
|
Synonyms | FMOC-D-LYS(Z)-OH Fmoc-D-Lys(Z)-OH FMOC-D-LYSINE(Z)-OH FMOC-N-EPSILON-Z-D-LYSINE N-ALPHA-FMOC-N-EPSILON-BENZYLOXYCARBONYL-D-LYSINE N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-EPSILON-CARBOBENZOXY-D-LYSINE D-Lysine, N2-(9H-fluoren-9-ylmethoxy)carbonyl-N6-(phenylmethoxy)carbonyl- N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-N-EPSILON-(BENZYL-OXYCARBONYL)-D-LYSINE N-ALPHA-(9-FLUOROENYLMETHYLOXYCARBONYL)-N-EPSILON-(BENZYL-OXYCARBONYL)-D-LYSINE
|
CAS | 110990-07-3
|
InChI | InChI=1/C29H30N2O6/c32-27(33)26(16-8-9-17-30-28(34)36-18-20-10-2-1-3-11-20)31-29(35)37-19-25-23-14-6-4-12-21(23)22-13-5-7-15-24(22)25/h1-7,10-15,25-26H,8-9,16-19H2,(H,30,34)(H,31,35)(H,32,33)/t26-/m1/s1 |
FMOC-D-LYS(Z)-OH - Physico-chemical Properties
Molecular Formula | C29H30N2O6
|
Molar Mass | 502.56 |
Density | 1.261±0.06 g/cm3(Predicted) |
Melting Point | 106-110℃ |
Boling Point | 751.2±60.0 °C(Predicted) |
Flash Point | 408.1°C |
Vapor Presure | 1.04E-23mmHg at 25°C |
Appearance | Powder |
Color | White |
pKa | 3.88±0.21(Predicted) |
Storage Condition | Sealed in dry,2-8°C |
Refractive Index | 1.603 |
FMOC-D-LYS(Z)-OH - Introduction
N-Fmoc-N '-Cbz-D-lysine is an organic compound with the following properties:
Nature:
1. Appearance is white crystalline solid;
2. the molecular formula is C34H31N3O5;
3. The molecular weight is 573.63g/mol.
Use:
N-Fmoc-N '-Cbz-D-lysine is mainly used in solid phase synthesis technology, and can be used for peptide synthesis and modification. It can be used as an amine protecting group, protecting the α-amino group and thus preventing non-specific reactions with other reactants. In addition, it can also be used in drug discovery and biochemical research.
Preparation Method:
The preparation method of N-Fmoc-N-Cbz-D-lysine is as follows:
1. First, the Fmoc protecting group is introduced into the N-terminal of D-lysine molecule by chemical reaction to obtain N-Fmoc-D-lysine;
2. Next, a Cbz protecting group was introduced into the side chain carboxyl group of N-Fmoc-D-lysine to obtain N-Fmoc-N '-Cbz-D-lysine.
Safety Information:
1. N-Fmoc-N '-Cbz-D-lysine specific safety information needs to be evaluated according to its chemical properties and specific uses, so laboratory safety procedures should be followed when using;
2. During operation, try to avoid contact with skin and eyes to avoid irritation or damage;
3. in case of accidental contact or accidental ingestion, rinse immediately with plenty of water and seek medical help;
4. Please store and handle the compound properly to avoid reaction with other chemicals or leakage.
Last Update:2024-04-09 21:01:54