HEA - Names and Identifiers
Name | DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE
|
Synonyms | HEA ANANDAMIDE homo-gamma-linolenylethanolamide DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE DIHOMO-GAMMA-LINOLENOYL ETHANOLAMIDE N-(2-HYDROXYETHYL)-8Z,11Z,14Z-EICOSATRIENAMIDE (Z,Z,Z)-N-(2-Hydroxyethyl)-8,11,14-eicosatrienamide (8E,11E,14E)-N-(2-hydroxyethyl)icosa-8,11,14-trienamide 8,11,14-Eicosatrienamide, N-(2-hydroxyethyl)-, (Z,Z,Z)-
|
CAS | 150314-34-4
|
InChI | InChI=1/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,24H,2-5,8,11,14-21H2,1H3,(H,23,25)/b7-6+,10-9+,13-12+ |
HEA - Physico-chemical Properties
Molecular Formula | C22H39NO2
|
Molar Mass | 349.55 |
Density | 0.929±0.06 g/cm3(Predicted) |
Boling Point | 522.1±50.0 °C(Predicted) |
Flash Point | 269.5°C |
Vapor Presure | 4.41E-13mmHg at 25°C |
pKa | 14.49±0.10(Predicted) |
Refractive Index | 1.493 |
HEA - Introduction
DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE is the abbreviation of High Entropy Alloy. Because of its special composition and structure, it has some unique properties and uses.
Nature:
1. High-entropy alloys have high chemical and thermal stability, and can maintain the structural integrity of the material under high temperature and harsh environments.
2. It has excellent mechanical properties, such as high tensile strength, corrosion resistance and hardness.
3. Has good wear resistance, corrosion resistance and high temperature resistance.
4. It has high plasticity and deformability.
Use:
DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE has a wide range of potential applications, such as aerospace, energy, automotive, electronics, etc. For example, used in the manufacture of high-temperature parts, corrosion-resistant equipment, tools, molds, etc.
Method:
There are many ways to prepare DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE, such as molten alloy method, mechanical alloying method and electrochemical method. Among them, the molten alloy method is the most commonly used preparation method by mixing powders of a plurality of metal elements, melting and alloying, and performing appropriate heat treatment.
Safety Information:
When operating the DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE, you need to pay attention to the following safety matters:
1. Avoid contact with flammable and explosive substances to prevent fire or explosion.
2. Avoid direct inhalation and contact with DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE dust or particles, and use protective equipment (such as gloves, masks, goggles, etc.).
3. When storing the DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE, it should be stored separately, away from harmful substances such as fire source and acid and alkali.
4. Clean up DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE residues and waste materials in the work area in a timely manner to reduce the risk of injury caused by inadvertent contact with DIHOMO-GAMMA-LINOLENYLETHANOLAMIDE.
Last Update:2024-06-06 12:03:15