HEXAHYDROMESITYLENE
1,3,5-trimethylcyclohexane
CAS: 1839-63-0
Molecular Formula: C9H18
HEXAHYDROMESITYLENE - Names and Identifiers
| Name | 1,3,5-trimethylcyclohexane |
| Synonyms | HEXAHYDROMESITYLENE 1,3,5-Trimethylcyclohexane 1,3,5-trimethylcyclohexane 1,3,5-TRIMETHYLCYCLOHEXANE Cyclohexane, 1,3,5-trimethyl- |
| CAS | 1839-63-0 |
| EINECS | 217-417-0 |
| InChI | InChI=1/C9H18/c1-7-4-8(2)6-9(3)5-7/h7-9H,4-6H2,1-3H3 |
HEXAHYDROMESITYLENE - Physico-chemical Properties
| Molecular Formula | C9H18 |
| Molar Mass | 126.24 |
| Density | 0.77 |
| Melting Point | -50 °C |
| Boling Point | 140°C |
| Flash Point | 19°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Refractive Index | 1.4260 to 1.4290 |
HEXAHYDROMESITYLENE - Risk and Safety
| Risk Codes | 11 - Highly Flammable |
| Safety Description | S9 - Keep container in a well-ventilated place. S16 - Keep away from sources of ignition. S33 - Take precautionary measures against static discharges. |
| UN IDs | 1993 |
| Hazard Class | 3 |
| Packing Group | II |
HEXAHYDROMESITYLENE - Introduction
1,3,5-trimethylcyclohexane, also known as isooctane, is an organic compound. The following is an introduction to its nature, purpose, production method, and safety information:
Nature:
1. 1,3,5-trimethylcyclohexane is a colorless liquid with an odor similar to alkanes.
2. It is insoluble in water and can dissolve in many organic solvents.
Usage:
1. 1,3,5-trimethylcyclohexane is mainly used as a solvent. Its volatility and relatively low toxicity make it commonly used in industrial applications such as coatings, cleaning agents, inks, and preservatives.
2. It is also used as a catalyst or reducing agent for certain reactions.
Method:
1,3,5-trimethylcyclohexane can be prepared by the following two methods:
1. Obtained through metal catalyzed hydrogenation of isooctene.
2. Obtain 1,4-dimethylcyclohexane through isomerization reaction under appropriate conditions.
Security information:
1. 1,3,5-trimethylcyclohexane has a relatively small impact on the environment. As an organic solvent, it has a certain degree of volatility, and attention should be paid to preventing poisoning caused by excessive inhalation.
2. When using, ensure good ventilation and avoid high temperatures and sources of ignition.
3. It is also flammable and should be stored in a cool and well ventilated place, away from sources of fire and oxidants.
4. Chemical protective gloves and protective goggles with sufficient protection should be worn during handling.
5. Please carefully read and follow the relevant safety data sheets and operating instructions when using and storing.
Last Update：2024-04-10 20:25:52
