INDOLE-3-ACETYL-L-VALINE(IAVal) - Names and Identifiers
Name | N-(3-indolylacetyl)-L-valine
|
Synonyms | IAA-L-VAL INDOLE-3-ACETYL-L-VALINE N-indol-3-ylacetyl-valine N-(3-indolylacetyl)-L-valine N-(3-INDOLYLACETYL)-L-VALINE N-(1H-indol-3-ylacetyl)valine INDOLE-3-ACETYL-L-VALINE(IAVal) N-(1H-indol-3-ylacetyl)-L-valine L-Valine, N-[2-(1H-indol-3-yl)acetyl]- (2S)-2-[[2-(1H-indol-3-yl)-1-oxoethyl]amino]-3-methylbutanoic acid
|
CAS | 57105-42-7
|
InChI | InChI=1/C15H18N2O3/c1-9(2)14(15(19)20)17-13(18)7-10-8-16-12-6-4-3-5-11(10)12/h3-6,8-9,14,16H,7H2,1-2H3,(H,17,18)(H,19,20) |
INDOLE-3-ACETYL-L-VALINE(IAVal) - Physico-chemical Properties
Molecular Formula | C15H18N2O3
|
Molar Mass | 274.32 |
Density | 1?+-.0.06 g/cm3(Predicted) |
Melting Point | 196-199°C(lit.) |
Boling Point | 589.4±40.0 °C(Predicted) |
Flash Point | 310.2°C |
Vapor Presure | 9.78E-15mmHg at 25°C |
pKa | 3.61±0.10(Predicted) |
Refractive Index | 1.615 |
INDOLE-3-ACETYL-L-VALINE(IAVal) - Risk and Safety
INDOLE-3-ACETYL-L-VALINE(IAVal) - Introduction
N-(3-indolylacetyl)-L-valine is an organic compound with the chemical formula C17H20N2O4.
Nature:
N-(3-indolylacetyl)-L-valine is a white crystalline solid, soluble in water and polar organic solvents.
Use:
N-(3-indolylacetyl)-L-valine is a commonly used drug intermediate, which can be used to synthesize antibiotics and other drugs.
Preparation Method:
N-(3-indolylacetyl)-L-valine is generally synthesized by acylation reaction. 3-indoleacetic acid reacts with L-valine under acidic conditions to generate the target product.
Safety Information:
N-(3-indolylacetyl)-L-valine safety information is limited, laboratory safety procedures need to be followed during use, handling and storage. In any case, personal protective measures such as wearing gloves, protective glasses and laboratory outer clothing are required. If exposed to the compound, rinse immediately with plenty of water and seek medical help.
Last Update:2024-04-09 20:44:15