Name | 4-Methoxy-3-hydroxyacetophenone |
Synonyms | NSC 30050 Isoacetovanillone Acetoisovanillone ACETOISOVANILLONE(SH) 5-Acetyl-2-methoxyphenol 3-hydroxy-4-methoxyacetophenone 3-HYDROXY-4-METHOXYACETOPHENONE 4-Methoxy-3-hydroxyacetophenone 1-(3-hydroxy-4-methoxyphenyl)ethanone 1-(3-hydroxy-4-Methoxyphenyl)ethan-1-one Ethanone, 1-(3-hydroxy-4-Methoxyphenyl)- |
CAS | 6100-74-9 |
EINECS | 211-589-0 |
InChI | InChI=1/C9H10O3/c1-6(10)7-3-4-9(12-2)8(11)5-7/h3-5,11H,1-2H3 |
Molecular Formula | C9H10O3 |
Molar Mass | 166.17 |
Density | 1.158 |
Melting Point | 88-92 °C |
Boling Point | 329.9±27.0 °C(Predicted) |
Flash Point | 135.7°C |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Vapor Presure | 8.96E-05mmHg at 25°C |
Appearance | Solid |
Color | Off-White to Yellow |
pKa | 9.15±0.10(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Stability | Stable. Incompatible with strong oxidizing agents. |
Sensitive | stable. Incompatible with strong oxidants. |
Refractive Index | 1.537 |
MDL | MFCD00182975 |
Hazard Symbols | Xn - Harmful![]() |
Risk Codes | 22 - Harmful if swallowed |
WGK Germany | 3 |