L-α-Phenylglycinamide
L-PHENYLGLYCINE AMIDE
CAS: 6485-52-5
Molecular Formula: C8H10N2O
L-α-Phenylglycinamide - Names and Identifiers
| Name | L-PHENYLGLYCINE AMIDE |
| Synonyms | H-PHG-NH2 HCL H-Phg-Nh2 Hcl H-L-PHG-NH2 HCL L-Phenylglycinamide L-α-Phenylglycinamide L-PHENYLGLYCINE AMIDE (S)-Phenylglycinamide (S)-Aminophenylacetamide (S)-α-Aminobenzeneacetamide (2S)-2-Amino-2-phenylacetamide (2S)-2-Phenyl-2-aminoacetamide (2S)-2-amino-2-phenylethanamide L-PHENYLGLYCINE AMIDE HYDROCHLORIDE L-PHENYLGLYCINE ESTER-ALPHA-AMIDE HYDROCHLORIDE |
| CAS | 6485-52-5 |
| EINECS | 813-110-6 |
| InChI | InChI=1/C8H10N2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H2,10,11)/t7-/m0/s1 |
L-α-Phenylglycinamide - Physico-chemical Properties
| Molecular Formula | C8H10N2O |
| Molar Mass | 150.18 |
| Density | 1.178±0.06 g/cm3(Predicted) |
| Melting Point | 131-132 °C |
| Boling Point | 322.8±35.0 °C(Predicted) |
| Flash Point | 149°C |
| Vapor Presure | 0.000272mmHg at 25°C |
| Appearance | White crystal |
| pKa | 15.61±0.50(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,2-8°C |
| Refractive Index | 1.588 |
| MDL | MFCD03791027 |
L-α-Phenylglycinamide - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 43 - May cause sensitization by skin contact |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
L-α-Phenylglycinamide - Introduction
L-PHENYLGLYCINE AMIDE(L-PHENYLGLYCINE AMIDE) has the formula C9H10N2O2 and is an organic compound. Its properties are as follows:
1. Appearance: L-PHENYLGLYCINE AMIDE is a white crystalline solid.
2. Solubility: It is soluble in water and ethanol, slightly soluble in ether and chloroform.
3. melting point: the melting point of L-PHENYLGLYCINE AMIDE is about 130-132 ℃.
4. Stability: It is relatively stable at room temperature.
The purpose of L-PHENYLGLYCINE AMIDE is as follows:
1. pharmaceutical industry: L-PHENYLGLYCINE AMIDE is an important synthetic intermediate, commonly used in the synthesis of pharmaceutical intermediates and pharmaceutical active ingredients.
2. Cosmetic industry: It can also be used in the production of certain cosmetics, such as certain anti-aging cosmetics.
3. scientific research purposes: L-PHENYLGLYCINE AMIDE can also be used in the field of scientific research, for example, as an enzyme activator, enzyme inhibitor, etc.
The preparation method of L-PHENYLGLYCINE AMIDE mainly includes the following steps:
1. Taking L-phenylalanine as raw material, it was converted to L-phenylglycine by acid-catalyzed reaction.
2. L-phenylglycolic acid reacts with amino alcohol to generate L-PHENYLGLYCINE AMIDE.
For safety information about L-PHENYLGLYCINE AMIDE, note the following:
1. toxicity: L-PHENYLGLYCINE AMIDE has no obvious toxicity to human body at general concentration.
2. Irritation: may cause irritation to the eyes, skin and respiratory system, and should be protected when using.
3. transportation and storage: avoid contact with strong oxidant, strong acid and strong alkali, and keep away from open flame and high temperature environment.
When using and handling L-PHENYLGLYCINE AMIDE, please follow the specific experimental requirements and follow the relevant safety operation specifications.
1. Appearance: L-PHENYLGLYCINE AMIDE is a white crystalline solid.
2. Solubility: It is soluble in water and ethanol, slightly soluble in ether and chloroform.
3. melting point: the melting point of L-PHENYLGLYCINE AMIDE is about 130-132 ℃.
4. Stability: It is relatively stable at room temperature.
The purpose of L-PHENYLGLYCINE AMIDE is as follows:
1. pharmaceutical industry: L-PHENYLGLYCINE AMIDE is an important synthetic intermediate, commonly used in the synthesis of pharmaceutical intermediates and pharmaceutical active ingredients.
2. Cosmetic industry: It can also be used in the production of certain cosmetics, such as certain anti-aging cosmetics.
3. scientific research purposes: L-PHENYLGLYCINE AMIDE can also be used in the field of scientific research, for example, as an enzyme activator, enzyme inhibitor, etc.
The preparation method of L-PHENYLGLYCINE AMIDE mainly includes the following steps:
1. Taking L-phenylalanine as raw material, it was converted to L-phenylglycine by acid-catalyzed reaction.
2. L-phenylglycolic acid reacts with amino alcohol to generate L-PHENYLGLYCINE AMIDE.
For safety information about L-PHENYLGLYCINE AMIDE, note the following:
1. toxicity: L-PHENYLGLYCINE AMIDE has no obvious toxicity to human body at general concentration.
2. Irritation: may cause irritation to the eyes, skin and respiratory system, and should be protected when using.
3. transportation and storage: avoid contact with strong oxidant, strong acid and strong alkali, and keep away from open flame and high temperature environment.
When using and handling L-PHENYLGLYCINE AMIDE, please follow the specific experimental requirements and follow the relevant safety operation specifications.
Last Update：2024-04-09 18:58:34
Supplier List
Product Name: H-Phg-NH2 Hcl Visit Supplier Webpage Request for quotation
CAS: 6485-52-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6485-52-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: H-Phg-NH2 Hcl Visit Supplier Webpage Request for quotation
CAS: 6485-52-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 6485-52-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History