METHYL-4-NITRO-2-CHLOROBENZOATE
Methyl 2-chloro-4-nitrobenzoate
CAS: 13324-11-3
Molecular Formula: C8H6ClNO4
METHYL-4-NITRO-2-CHLOROBENZOATE - Names and Identifiers
| Name | Methyl 2-chloro-4-nitrobenzoate |
| Synonyms | LIXI-002 BUTTPARK 94 4-05 METHYL 2-CHLORO-4-NITROBENZOATE METHYL-4-NITRO-2-CHLOROBENZOATE Methyl 2-chloro-4-nitrobenzoate 4-NITRO-2-CHLOROBENZOIC ACID METHYL ESTER 2-CHLORO-4-NITROBENZOIC ACID METHYL ESTER 2-Chloro-4-nitrobenzoic acid methyl ester Benzoic acid, 2-chloro-4-nitro-, methyl ester |
| CAS | 13324-11-3 |
| EINECS | 236-362-3 |
| InChI | InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3 |
METHYL-4-NITRO-2-CHLOROBENZOATE - Physico-chemical Properties
| Molecular Formula | C8H6ClNO4 |
| Molar Mass | 215.59 |
| Density | 1.426±0.06 g/cm3(Predicted) |
| Melting Point | 77-78 °C |
| Boling Point | 324.8±27.0 °C(Predicted) |
| Flash Point | 150.2°C |
| Vapor Presure | 0.00024mmHg at 25°C |
| Appearance | Powder |
| Color | Almost beige |
| BRN | 1877723 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.568 |
METHYL-4-NITRO-2-CHLOROBENZOATE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| HS Code | 38220090 |
| Hazard Class | IRRITANT |
METHYL-4-NITRO-2-CHLOROBENZOATE - Introduction
Methyl 2-chloro-4-nitrobenzoate is an organic compound with the formula C8H6ClNO4. Its properties are as follows:
1. Appearance: 2-Chloro-4-nitrobenzoic acid methyl ester is a white crystalline solid.
2. melting point: its melting point is about 45 ℃.
3. Boiling point: Its boiling point is about 295 ℃.
4. density: its density is about 1.47g/cm3.
5. Solubility: 2-chloro-4-nitrobenzoic acid methyl ester is soluble in ethanol, chloroform and acetone, but insoluble in water.
The main uses of methyl 2-chloro-4-nitrobenzoate are as pesticides and biocides. It can effectively fight weeds and pests and protect the growth of crops.
There are generally two methods for preparing methyl 2-chloro -4-nitrobenzoate. One is obtained by chlorination of methyl p-nitrobenzoate, and the other is obtained by alkyd reaction of 2-chloro-4-nitrobenzoic acid.
Regarding safety information, methyl 2-chloro-4-nitrobenzoate is a toxic substance and direct contact with skin, eyes and respiratory tract should be avoided. Use should take appropriate protective measures, such as wearing protective gloves and protective glasses. In addition, it should be stored in a cool, dry and well-ventilated place, away from fire and oxidizing agents. If ingested or inhaled, seek medical attention immediately.
1. Appearance: 2-Chloro-4-nitrobenzoic acid methyl ester is a white crystalline solid.
2. melting point: its melting point is about 45 ℃.
3. Boiling point: Its boiling point is about 295 ℃.
4. density: its density is about 1.47g/cm3.
5. Solubility: 2-chloro-4-nitrobenzoic acid methyl ester is soluble in ethanol, chloroform and acetone, but insoluble in water.
The main uses of methyl 2-chloro-4-nitrobenzoate are as pesticides and biocides. It can effectively fight weeds and pests and protect the growth of crops.
There are generally two methods for preparing methyl 2-chloro -4-nitrobenzoate. One is obtained by chlorination of methyl p-nitrobenzoate, and the other is obtained by alkyd reaction of 2-chloro-4-nitrobenzoic acid.
Regarding safety information, methyl 2-chloro-4-nitrobenzoate is a toxic substance and direct contact with skin, eyes and respiratory tract should be avoided. Use should take appropriate protective measures, such as wearing protective gloves and protective glasses. In addition, it should be stored in a cool, dry and well-ventilated place, away from fire and oxidizing agents. If ingested or inhaled, seek medical attention immediately.
Last Update：2024-04-10 22:29:15
