Methyla-bromo-a-phenylacetate
methyl alpha-bromophenylacetate
CAS: 3042-81-7
Molecular Formula: C9H9BrO2
Methyla-bromo-a-phenylacetate - Names and Identifiers
| Name | methyl alpha-bromophenylacetate |
| Synonyms | -altropyranoside Methyl bromophenylacetate Methyla-bromobenzeneacetate Methyla-bromo-a-phenylacetate Methyl2-bromo-2-phenylacetate methyl alpha-bromophenylacetate Methyl alpha-bromobenzeneacetate ALPHA-BROMOPHENYLACETIC ACID METHYL ESTER -(1H-1,2,4-triazol-1-ylmethyl)-4-pyrimidineethanol-d3 |
| CAS | 3042-81-7 |
| EINECS | 608-480-9 |
| InChI | InChI=1/C9H9BrO2/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6,8H,1H3/t8-/m1/s1 |
| InChIKey | NHFBYYMNJUMVOT-UHFFFAOYSA-N |
Methyla-bromo-a-phenylacetate - Physico-chemical Properties
| Molecular Formula | C9H9BrO2 |
| Molar Mass | 229.07 |
| Density | 1.46g/mLat 20°C(lit.) |
| Boling Point | 113°C3mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00579mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light orange to Yellow |
| BRN | 1102743 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.554 |
Methyla-bromo-a-phenylacetate - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/39 - S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Class | 8 |
| Packing Group | II |
Methyla-bromo-a-phenylacetate - Nature
| boiling point | 113 °C3mm Hg(lit.) |
| density | 1.46 g/mL at 20 °C(lit.) |
| refractive index | n20/D 1.554 |
| flash point | >230 °F |
| storage conditions | 2-8°C |
| BRN | 1102743 |
| InChIKey | NHFBYYMNJUMVOT-UHFFFAOYSA-N |
Last Update：2024-04-10 22:29:15
Methyla-bromo-a-phenylacetate - Security information
| dangerous goods mark | C |
| hazard category code | 36/37/38-34 |
| safety instructions | 26-36/39-45-36/37/39 |
| dangerous goods transport number | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| customs code | 29163990 |
Last Update：2024-04-10 22:29:15
