N-(2-chlorophenyl)-4-nitro-beta-oxobenzenepropionamide
2'-CHLORO-2-(4-NITROBENZOYL)ACETANILIDE
CAS: 62254-06-2
Molecular Formula: C15H11ClN2O4
N-(2-chlorophenyl)-4-nitro-beta-oxobenzenepropionamide - Names and Identifiers
| Name | 2'-CHLORO-2-(4-NITROBENZOYL)ACETANILIDE |
| Synonyms | 2'-CHLORO-2-(4-NITROBENZOYL)ACETANILIDE 1-[(4-NITRO-BENZOYL)-ACETAMINO]-2-CHLORO-BENZENE 1-[(4-NITROBENZOYL)-2-ACETAMIDO]-2-CHLOROBENZENE Benzenepropanamide, N-(2-chlorophenyl)-4-nitro-β-oxo- N-(2-chlorophenyl)-4-nitro-beta-oxobenzenepropionamide |
| CAS | 62254-06-2 |
N-(2-chlorophenyl)-4-nitro-beta-oxobenzenepropionamide - Physico-chemical Properties
| Molecular Formula | C15H11ClN2O4 |
| Molar Mass | 318.71 |
| Density | 1.434±0.06 g/cm3(Predicted) |
| Melting Point | 148°C(lit.) |
| Boling Point | 558.6±40.0 °C(Predicted) |
| pKa | 8.88±0.25(Predicted) |
N-(2-chlorophenyl)-4-nitro-beta-oxobenzenepropionamide - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
