N-ALPHA-Z-D-LYSINE
N(alpha)-Z-D-lysine
CAS: 70671-54-4
Molecular Formula: C14H20N2O4
N-ALPHA-Z-D-LYSINE - Names and Identifiers
| Name | N(alpha)-Z-D-lysine |
| Synonyms | Z-D-LYSINE Z-D-LYS-OH Z-D-Lys-OH CBZ-D-LYSINE N2-Cbz-D-lysine na-cbz-D-lysine N-ALPHA-Z-D-LYSINE N(alpha)-Z-D-lysine N-ALPHA-CBZ-D-LYSINE N-BENZYLOXYCARBONYL-D-LYSINE N-ALPHA-CARBOBENZOXY-D-LYSINE N-ALPHA-BENZYLOXYCARBONYL-D-LYSINE (2R)-6-ammonio-2-{[(benzyloxy)carbonyl]amino}hexanoate |
| CAS | 70671-54-4 |
| InChI | InChI=1/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m1/s1 |
N-ALPHA-Z-D-LYSINE - Physico-chemical Properties
| Molecular Formula | C14H20N2O4 |
| Molar Mass | 280.32 |
| Density | 1.206±0.06 g/cm3(Predicted) |
| Melting Point | 218 °C |
| Boling Point | 497.0±45.0 °C(Predicted) |
| Flash Point | 254.4°C |
| Vapor Presure | 1.07E-10mmHg at 25°C |
| Appearance | Crystalline |
| Color | White |
| BRN | 5290234 |
| pKa | 3.90±0.21(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.55 |
| MDL | MFCD00067713 |
N-ALPHA-Z-D-LYSINE - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29242990 |
N-ALPHA-Z-D-LYSINE - Introduction
N(alpha)-Z-D-lysine (also known as N(alpha)-Z-D-lysine) is an organic compound that belongs to a class of amino acids. Its molecular formula is C19H24N2O4 and its molecular weight is 352.41g/mol.
N(alpha)-Z-D-lysine have the following properties:
1. appearance: the common form is white crystalline powder.
2. Stability: It is relatively stable at room temperature, but may be degraded by light and heat.
3. Solubility: It can be dissolved in some organic solvents, such as chloroform and dimethylformamide (DMF), but the solubility is low.
N(alpha)-Z-D-lysine have a wide range of applications in the chemical and biological sciences:
1. As an intermediate for the synthesis of polypeptides: N(alpha)-Z-D-lysine can be used as a protecting group during the synthesis of polypeptides to prevent accidental modification of specific functional groups.
2. Drug research: The compound can be used to synthesize drugs and drug carriers for drug release and delivery.
3. biological activity research: N(alpha)-Z-D-lysine can be used to study the construction and properties of bioactive peptides.
N(alpha)-Z-D-lysine is generally prepared by the following steps:
1. First, lysine is reacted with orthouremic acid (Cbz-Cl) to generate an intermediate of Cbz-lysine.
2. Then, by removing the protecting group in the intermediate (for example, by adding chloroformic acid), pure N(alpha)-Z-D-lysine is obtained.
Regarding safety information, N(alpha)-Z-D-lysine is relatively safe under general operating conditions. However, it is necessary to follow laboratory safety regulations and operating guidelines, avoid direct contact with skin and eyes, and avoid inhaling dust. If necessary, refer to the specific Safety Data Sheet (SDS) and take appropriate precautions before using chemicals.
N(alpha)-Z-D-lysine have the following properties:
1. appearance: the common form is white crystalline powder.
2. Stability: It is relatively stable at room temperature, but may be degraded by light and heat.
3. Solubility: It can be dissolved in some organic solvents, such as chloroform and dimethylformamide (DMF), but the solubility is low.
N(alpha)-Z-D-lysine have a wide range of applications in the chemical and biological sciences:
1. As an intermediate for the synthesis of polypeptides: N(alpha)-Z-D-lysine can be used as a protecting group during the synthesis of polypeptides to prevent accidental modification of specific functional groups.
2. Drug research: The compound can be used to synthesize drugs and drug carriers for drug release and delivery.
3. biological activity research: N(alpha)-Z-D-lysine can be used to study the construction and properties of bioactive peptides.
N(alpha)-Z-D-lysine is generally prepared by the following steps:
1. First, lysine is reacted with orthouremic acid (Cbz-Cl) to generate an intermediate of Cbz-lysine.
2. Then, by removing the protecting group in the intermediate (for example, by adding chloroformic acid), pure N(alpha)-Z-D-lysine is obtained.
Regarding safety information, N(alpha)-Z-D-lysine is relatively safe under general operating conditions. However, it is necessary to follow laboratory safety regulations and operating guidelines, avoid direct contact with skin and eyes, and avoid inhaling dust. If necessary, refer to the specific Safety Data Sheet (SDS) and take appropriate precautions before using chemicals.
Last Update：2024-04-09 21:01:54
Supplier List
Product Name: Nalpha-Cbz-D-Lysine Visit Supplier Webpage Request for quotation
CAS: 70671-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 70671-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Nalpha-Cbz-D-Lysine Visit Supplier Webpage Request for quotation
CAS: 70671-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 70671-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History