N-Benzyloxycarbonyl-L-Prolinamide
Z-Pro-NH2
CAS: 34079-31-7
Molecular Formula: C13H16N2O3
N-Benzyloxycarbonyl-L-Prolinamide - Names and Identifiers
| Name | Z-Pro-NH2 |
| Synonyms | Z-Pro-NH2 Z-PRO-NH2 Z-L-PROLINAMIDE Z-L-PROLINE AMIDE Cbz-L-prolinamide Z-L-proline amide (S)-1-N-CBZ-PROLINAMIDE (S)-1-N-Cbz-prolinamide N-CARBOBENZOXY-L-PROLINE AMIDE (S)-2-CARBAMOYL-1-CBZ-PYRROLIDINE N-Benzyloxycarbonyl-L-Prolinamide N-ALPHA-CARBOBENZOXY-L-PROLINE AMIDE (S)-benzyl 2-carbamoylpyrrolidine-1-carboxylate benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate (S)-2-CARBAMOYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER N-ALPHA-CARBOBENZOXY-L-PYRROLIDINE-2-CARBOXYLIC ACID ALPHA-AMIDE 2-(aminocarbonyl)-1-Pyrrolidinecarboxylic acid phenylmethyl ester |
| CAS | 34079-31-7 |
| EINECS | 231-397-0 |
| InChI | InChI=1/C13H16N2O3/c14-12(16)11-7-4-8-15(11)13(17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,14,16)/t11-/m0/s1 |
N-Benzyloxycarbonyl-L-Prolinamide - Physico-chemical Properties
| Molecular Formula | C13H16N2O3 |
| Molar Mass | 248.28 |
| Density | 1.263±0.06 g/cm3(Predicted) |
| Melting Point | 90-95℃ |
| Boling Point | 465.6±44.0 °C(Predicted) |
| Flash Point | 235.4°C |
| Vapor Presure | 7.61E-09mmHg at 25°C |
| Appearance | White powder |
| pKa | 15.95±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.581 |
| MDL | MFCD00020830 |
N-Benzyloxycarbonyl-L-Prolinamide - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29339900 |
N-Benzyloxycarbonyl-L-Prolinamide - Introduction
Z-Pro-NH2(Z-Pro-NH2) is an organic compound that belongs to the derivatives of proline. Its molecular formula is C13H16N2O3 and its molecular weight is 252.28g/mol.
Nature:
-Appearance: A white crystalline solid.
-Melting point: about 115-117°C.
-Solubility: Good solubility in some organic solvents such as ethanol, dimethylformamide and chloroform.
Use:
- Z-Pro-NH2 is an important synthetic intermediate that can be used to synthesize other compounds in organic synthesis reactions.
-It is commonly used in pharmaceutical chemistry synthesis strategies, such as the synthesis of peptide drugs and chiral drug molecules.
Preparation Method:
Z-Pro-NH2 are usually synthesized by the following steps:
1. First, proline reacts with benzyl chloride to generate Cbz-L-proline benzyl ester.
2. Next, the Cbz-L-proline benzyl ester is subjected to a hydrolysis reaction to generate Cbz-L-proline.
3. Finally, Cbz-L-proline reacts with carbamic acid dehydrating agent to generate Z-Pro-NH2.
Safety Information:
Z-Pro-NH2 is a chemical and should be stored properly and in accordance with general laboratory safety practices. During use, avoid direct contact with skin and eyes, and avoid inhaling dust. If there is contact, should immediately rinse with plenty of water, and medical examination. Ignition and other flammable materials should be avoided during operation.
Nature:
-Appearance: A white crystalline solid.
-Melting point: about 115-117°C.
-Solubility: Good solubility in some organic solvents such as ethanol, dimethylformamide and chloroform.
Use:
- Z-Pro-NH2 is an important synthetic intermediate that can be used to synthesize other compounds in organic synthesis reactions.
-It is commonly used in pharmaceutical chemistry synthesis strategies, such as the synthesis of peptide drugs and chiral drug molecules.
Preparation Method:
Z-Pro-NH2 are usually synthesized by the following steps:
1. First, proline reacts with benzyl chloride to generate Cbz-L-proline benzyl ester.
2. Next, the Cbz-L-proline benzyl ester is subjected to a hydrolysis reaction to generate Cbz-L-proline.
3. Finally, Cbz-L-proline reacts with carbamic acid dehydrating agent to generate Z-Pro-NH2.
Safety Information:
Z-Pro-NH2 is a chemical and should be stored properly and in accordance with general laboratory safety practices. During use, avoid direct contact with skin and eyes, and avoid inhaling dust. If there is contact, should immediately rinse with plenty of water, and medical examination. Ignition and other flammable materials should be avoided during operation.
Last Update：2024-04-09 21:01:54
Supplier List
Spot supply
Product Name: Z-Pro-NH2 Visit Supplier Webpage Request for quotationCAS: 34079-31-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Z-Pro-NH2 Visit Supplier Webpage Request for quotationCAS: 34079-31-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History