N-CBZ-4-AMINO-CYCLOHEXANOL - Names and Identifiers
Name | N-CBZ-4-HYDROXYCYCLOHEXANE
|
Synonyms | 4-(Z-AMINO)CYCLOHEXANOL N-CBZ-4-AMINO-CYCLOHEXANOL N-CBZ-4-HYDROXYCYCLOHEXANE N-Cbz-4-hydroxycyclohexanamine (Cbz-amino)-4-hydroxycyclohexane N-Carboxybenzyl-4-hydroxycyclohexane benzyl (4-hydroxycyclohexyl)carbamate trans-1-Cbz-amino-4-hydroxycyclohexane Carbamic acid, (4-hydroxycyclohexyl)-, phenylmethyl ester Carbamic acid, (4-hydroxycyclohexyl)-, phenylmethyl ester (9CI) ((4-Hydroxycyclohexyl)carbamic acid benzyl ester), (Cbz-amino)-4-hydroxycyclohexane ((4-Hydroxycyclohexyl)carbamic acid benzyl ester), (Cbz-amino)-4-hydroxycyclohexane
|
CAS | 16801-62-0
|
InChI | InChI=1/C14H19NO3/c16-13-8-6-12(7-9-13)15-14(17)18-10-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10H2,(H,15,17) |
N-CBZ-4-AMINO-CYCLOHEXANOL - Physico-chemical Properties
Molecular Formula | C14H19NO3
|
Molar Mass | 249.31 |
Density | 1.17g/cm3 |
Melting Point | 161-165°C |
Boling Point | 427.6°C at 760 mmHg |
Flash Point | 212.4°C |
Vapor Presure | 4.51E-08mmHg at 25°C |
Storage Condition | Room Temprature |
Refractive Index | 1.56 |
MDL | MFCD02728352 |
N-CBZ-4-AMINO-CYCLOHEXANOL - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | 22 - Harmful if swallowed
|
WGK Germany | 3 |
N-CBZ-4-AMINO-CYCLOHEXANOL - Introduction
N-CBZ-4-HYDROXYCYCLOHEXANE is an organic compound, its molecular formula is CFIS? H? NO?, and the structural formula is Cbz-NH (ch₂). OH. The following is a description of its nature, use, preparation and safety information:
Nature:
N-CBZ-4-HYDROXYCYCLOHEXANE is a colorless or yellowish Crystal, soluble in common organic solvents. It has a lower melting point and boiling point and is a compound in the solid state.
Use:
N-CBZ-4-HYDROXYCYCLOHEXANE are widely used in organic synthesis. It can be used as a synthesis catalyst, a chiral resolution reagent, a pharmaceutical intermediate, etc. It is also used in the synthesis of biologically active compounds, such as anti-tumor drugs, hormone drugs, etc.
Method:
N-CBZ-4-HYDROXYCYCLOHEXANE can be prepared by the following steps:
1. Dissolve 4-aminocyclohexanol in dichloromethane.
2. Add chloroformyl chloride (Cbz-Cl) in dichloromethane.
3. Stir the reaction at room temperature for a certain time.
4. Add brine and separate the organic phase.
5. Filtration gave a solid product.
6. Recrystallization purification to obtain N-CBZ-4-HYDROXYCYCLOHEXANE.
Safety Information:
N-CBZ-4-HYDROXYCYCLOHEXANE is relatively safe under normal operation, but appropriate laboratory operation and personal protective measures are still needed. Avoid contact with skin, eyes and respiratory tract, avoid ingestion. If contact or ingestion occurs, rinse immediately with water and seek medical help. At the same time, in the use and storage process to comply with the relevant safety regulations and operating procedures.
Last Update:2024-04-09 21:11:58