N-ETHYL-N-ISOPROPYLANILINE
N-ethyl-N-isopropylaniline
CAS: 54813-77-3
Molecular Formula: C11H17N
N-ETHYL-N-ISOPROPYLANILINE - Names and Identifiers
| Name | N-ethyl-N-isopropylaniline |
| Synonyms | N-ethyl-N-isopropylaniline N-ETHYL-N-ISOPROPYLANILINE N-ethyl-N-propan-2-ylaniline N-ethyl-N-(1-methylethyl)aniline Benzenamine, N-ethyl-N-(1-methylethyl)- |
| CAS | 54813-77-3 |
| InChI | InChI=1/C11H17N/c1-4-12(10(2)3)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3 |
N-ETHYL-N-ISOPROPYLANILINE - Physico-chemical Properties
| Molecular Formula | C11H17N |
| Molar Mass | 163.26 |
| Density | 0.926g/mLat 25°C(lit.) |
| Melting Point | 46.25°C (estimate) |
| Boling Point | 223-225°C(lit.) |
| Flash Point | 194°F |
| Vapor Presure | 0.0771mmHg at 25°C |
| pKa | 7.38±0.20(Predicted) |
| Refractive Index | n20/D 1.534(lit.) |
N-ETHYL-N-ISOPROPYLANILINE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | NA 1993 / PGIII |
| WGK Germany | 3 |
N-ETHYL-N-ISOPROPYLANILINE - Introduction
N-ethyl-N-isopropylaniline is an organic compound with the chemical formula C11H17N. It is a colorless to pale yellow liquid with a special aromatic odor. The following is a description of the nature, use, preparation and safety information of the N-ethyl-N-isopropylaniline:
Nature:
1. Density: about 0.88 g/ml;
2. Boiling point: about 207-208 degrees Celsius;
3. melting point: about -21 degrees Celsius;
4. Solubility: It can be dissolved in various organic solvents.
Use:
1. N-ethyl-N-isopropylaniline is often used as an organic synthesis intermediate for the synthesis of other compounds, such as dyes, drugs, etc;
2. It can also be used as a rubber accelerator and antioxidant.
Preparation Method:
N-ethyl-N-isopropylaniline are generally prepared by the reaction of N-ethylaniline and isopropanol. The acid catalyst may be added during the reaction while heating and stirring. The product can be purified by distillation to obtain pure N-ethyl-N-isopropylaniline.
Safety Information:
1. N-ethyl-N-isopropylaniline is a flammable liquid, which needs to be kept away from fire and high temperature;
2. contact with skin and eyes may cause irritation, should avoid contact, and wear protective equipment;
3. inhalation of excessive steam or dust may cause respiratory irritation, should ensure good ventilation;
4. It is recommended to wear appropriate personal protective equipment during operation, such as gloves, goggles and protective clothing.
Nature:
1. Density: about 0.88 g/ml;
2. Boiling point: about 207-208 degrees Celsius;
3. melting point: about -21 degrees Celsius;
4. Solubility: It can be dissolved in various organic solvents.
Use:
1. N-ethyl-N-isopropylaniline is often used as an organic synthesis intermediate for the synthesis of other compounds, such as dyes, drugs, etc;
2. It can also be used as a rubber accelerator and antioxidant.
Preparation Method:
N-ethyl-N-isopropylaniline are generally prepared by the reaction of N-ethylaniline and isopropanol. The acid catalyst may be added during the reaction while heating and stirring. The product can be purified by distillation to obtain pure N-ethyl-N-isopropylaniline.
Safety Information:
1. N-ethyl-N-isopropylaniline is a flammable liquid, which needs to be kept away from fire and high temperature;
2. contact with skin and eyes may cause irritation, should avoid contact, and wear protective equipment;
3. inhalation of excessive steam or dust may cause respiratory irritation, should ensure good ventilation;
4. It is recommended to wear appropriate personal protective equipment during operation, such as gloves, goggles and protective clothing.
Last Update：2024-04-09 15:17:58
