Pyridine,3,4-dimethoxy-(9CI)
3,4-Dimethoxypyridine
CAS: 109613-93-6
Molecular Formula: C7H9NO2
Pyridine,3,4-dimethoxy-(9CI) - Names and Identifiers
| Name | 3,4-Dimethoxypyridine |
| Synonyms | 3,4-Dimethoxypyridine Pyridine, 3,4-dimethoxy- pyridine, 3,4-dimethoxy- Pyridine,3,4-dimethoxy-(9CI) |
| CAS | 109613-93-6 |
| InChI | InChI=1/C7H9NO2/c1-9-6-3-4-8-5-7(6)10-2/h3-5H,1-2H3 |
Pyridine,3,4-dimethoxy-(9CI) - Physico-chemical Properties
| Molecular Formula | C7H9NO2 |
| Molar Mass | 139.15 |
| Density | 1.064g/cm3 |
| Boling Point | 202.6°C at 760 mmHg |
| Flash Point | 72.9°C |
| Vapor Presure | 0.413mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.488 |
Pyridine,3,4-dimethoxy-(9CI) - Introduction
3,4-Dimethoxypyridine is an organic compound with the chemical formula C9H11NO2. It has the following properties:
1. Appearance: 3,4-dimethoxypyridine is a colorless to pale yellow liquid with a special fragrance.
2. Solubility: It is soluble in most organic solvents, such as ethanol, chloroform and dimethyl sulfoxide.
3. Stability: Stable at room temperature, but unstable under strong acid or alkali conditions.
3,4-Dimethoxypyridine has many applications:
1. chemical synthesis: it can be used as a reagent in organic synthesis and participate in a variety of organic reactions, such as substitution reactions, carbonylation reactions, etc.
2. Pharmacy: 3,4-dimethoxypyridine can be used as an intermediate for the synthesis of certain drugs, such as anticancer drugs.
3. Dye: It can also be used as a synthetic intermediate for dyes and used in the dye industry.
Regarding the preparation method, a commonly used synthesis method is to react pyridine with methanol under appropriate reaction conditions, and then undergo appropriate treatment to obtain 3,4-dimethoxypyridine.
When using, you need to pay attention to the following safety information:
1. Use should wear appropriate protective equipment, such as gloves and goggles.
2. avoid contact with skin and eyes, avoid inhalation or ingestion.
3. Operate in a well-ventilated place to avoid inhaling its vapor.
4. When storing, seal the container and avoid direct sunlight and high temperature.
1. Appearance: 3,4-dimethoxypyridine is a colorless to pale yellow liquid with a special fragrance.
2. Solubility: It is soluble in most organic solvents, such as ethanol, chloroform and dimethyl sulfoxide.
3. Stability: Stable at room temperature, but unstable under strong acid or alkali conditions.
3,4-Dimethoxypyridine has many applications:
1. chemical synthesis: it can be used as a reagent in organic synthesis and participate in a variety of organic reactions, such as substitution reactions, carbonylation reactions, etc.
2. Pharmacy: 3,4-dimethoxypyridine can be used as an intermediate for the synthesis of certain drugs, such as anticancer drugs.
3. Dye: It can also be used as a synthetic intermediate for dyes and used in the dye industry.
Regarding the preparation method, a commonly used synthesis method is to react pyridine with methanol under appropriate reaction conditions, and then undergo appropriate treatment to obtain 3,4-dimethoxypyridine.
When using, you need to pay attention to the following safety information:
1. Use should wear appropriate protective equipment, such as gloves and goggles.
2. avoid contact with skin and eyes, avoid inhalation or ingestion.
3. Operate in a well-ventilated place to avoid inhaling its vapor.
4. When storing, seal the container and avoid direct sunlight and high temperature.
Last Update：2024-04-09 21:49:45
Supplier List
Product Name: Pyridine,3,4-dimethoxy-(9CI) Visit Supplier Webpage Request for quotation
CAS: 109613-93-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 109613-93-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Pyridine,3,4-dimethoxy-(9CI) Visit Supplier Webpage Request for quotation
CAS: 109613-93-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 109613-93-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History