Name | Ropivacaine |
Synonyms | Naropin Naropine Ropivacaine ROPACARAINEHCL ROPIVACAINE MESYLATER (2S)-1-Propyl-2-(2,6-dimethylphenyl)carbamoylpiperidine N-(2,6-Dimethylphenyl)-1-propyl-piperidine-2-carboxamide 2-Piperidinecarboxamide, N-(2,6-dimethylphenyl)-1-propyl-, (2S)- |
CAS | 84057-95-4 |
EINECS | 200-001-8 |
InChI | InChI=1/C17H26N2O.CH4O3S/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;1-5(2,3)4/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H3,(H,2,3,4) |
InChIKey | ZKMNUMMKYBVTFN-HNNXBMFYSA-N |
Molecular Formula | C17H26N2O |
Molar Mass | 274.4 |
Density | 1.044±0.06 g/cm3(Predicted) |
Melting Point | 144-146° |
Boling Point | 410.2±45.0 °C(Predicted) |
Specific Rotation(α) | D25 -82.0° (c = 2 in methanol) |
Solubility | Aqueous Acid (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Sligh |
Appearance | Solid |
Color | White to Off-White |
pKa | 8.16(at 25℃) |
Storage Condition | Refrigerator |
Physical and Chemical Properties | Crystallized from toluene, melting point 144-146 °c. [Α] D23-82.0 °(C = 2, methanol). PKA 8.16. Partition coefficient (1-Octanol/aqueous buffer at pH 7.4):115.0. Ropivacaine Monohydrochloride: C17H26N2O? HCl. [98717-15-8]. Crystallization from isopropanol, melting point 260-262 °c. [Α] D23-6.6 °(C = 2, water). Ropivacaine Monohydrate Monohydrate: C17H126N2O? HCI? H2O. [132112-35-7]. Crystallization from acetone-water, melting point 269.5-270.6 °c. [Α] D20-7.28 °(C = 2, water) |
HS Code | 2933399090 |