Thiaxanthen
10H-dibenzo(b,e)thiin
CAS: 261-31-4
Molecular Formula: C13H10S
Thiaxanthen - Names and Identifiers
| Name | 10H-dibenzo(b,e)thiin |
| Synonyms | Thiaxanthen Thioxanthen Thiaxanthene THIOXANTHENE Thioxanthene thiaxanthene Thioxanethene 9H-thioxanthene 9H-Thioxanthene Dibenzothiapyran 10H-dibenzo(b,e)thiin 10h-dibenzo(b,e)thiin |
| CAS | 261-31-4 |
| EINECS | 205-972-1 |
| InChI | InChI=1/C13H10S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2 |
Thiaxanthen - Physico-chemical Properties
| Molecular Formula | C13H10S |
| Molar Mass | 198.28 |
| Density | 1.1424 (rough estimate) |
| Melting Point | 128-131°C |
| Boling Point | 340°C/730mmHg |
| Flash Point | 146.3°C |
| Vapor Presure | 0.000508mmHg at 25°C |
| Appearance | Crystals and Needles |
| Color | White |
| Refractive Index | 1.6720 (estimate) |
Thiaxanthen - Risk and Safety
| UN IDs | UN 3077 9 / PGIII |
| HS Code | 29349990 |
