Tri-2,4-xylylphosphine - Names and Identifiers
Name | Tris(2,4-dimethylphenyl)phosphine
|
Synonyms | TXP-2,4
Tri-2,4-xylylphosphine Tris(2,4-xylyl)phosphine tris(2,4-dimethylphenyl)phosphane Tris(2,4-dimethylphenyl)phosphine TRIS(2,4-DIMETHYLPHENYL)PHOSPHINE Phosphine, tris(2,4-dimethylphenyl)- Tris(2,4-dimethylphenyl)phosphine(TXP-2,4) TRIS(2,4-DIMETHYLPHENYL)PHOSPHINE fandachem
|
CAS | 49676-42-8
|
EINECS | 686-978-5 |
InChI | InChI=1/C24H27P/c1-16-7-10-22(19(4)13-16)25(23-11-8-17(2)14-20(23)5)24-12-9-18(3)15-21(24)6/h7-15H,1-6H3 |
Tri-2,4-xylylphosphine - Physico-chemical Properties
Molecular Formula | C24H27P
|
Molar Mass | 346.44 |
Melting Point | 157-158°C |
Boling Point | 447.6±45.0 °C(Predicted) |
Flash Point | 237.675°C |
Vapor Presure | 0mmHg at 25°C |
Appearance | Powder |
Color | white |
Storage Condition | Inert atmosphere,Room Temperature |
MDL | MFCD09039068 |
Tri-2,4-xylylphosphine - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | R22 - Harmful if swallowed
R36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
|
Tri-2,4-xylylphosphine - Introduction
Tris(2,4-dimethylphenyl)phosphine is an organophosphorus compound with the chemical formula (C6H3(CH3)2)3P. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: Tris(2,4-dimethylphenyl) is phosphine a colorless crystal or solid.
2. Melting point: The melting point of this compound is about 123-129°C.
3. Solubility: Soluble in common organic solvents.
Use:
1. Catalyst: Tris(2,4-dimethylphenyl)phosphine is widely used as a ligand in organic synthesis, especially in metal-catalyzed reactions, such as carbonylation, halogenation and reduction reactions.
2. Flame retardant: The compound has good flame retardant properties and can be used as a flame retardant for polymers.
Preparation Method:
Tris(2,4-dimethylphenyl)phosphine can be prepared by the following steps:
1. Using an organic solvent such as n-hexane as a reaction medium, 2,4-xylylboronic acid and triethylaminoborane are reacted under a nitrogen atmosphere to obtain a precursor compound of Tris(2,4-dimethylphenyl)phosphine.
2. The precursor compound is subjected to hydrogenation reaction under hydrogen atmosphere to obtain the final Tris (2,4-dimethy1 phenyl)phosphine product.
Safety Information:
1. Tris(2,4-dimethylphenyl)phosphine has low toxicity, but it is still necessary to take appropriate safety measures during operation, such as wearing protective gloves and glasses.
2. The compound may be potentially harmful to the water environment and needs to be avoided from entering the water body.
3. For safety reasons, it is recommended to handle the compound in a well-ventilated environment.
Last Update:2024-04-10 22:29:15