Tributylsulfoniumiodide
Tributylsulfoniumiodide
CAS: 18146-62-8
Molecular Formula: C12H27IS
Tributylsulfoniumiodide - Names and Identifiers
| Name | Tributylsulfoniumiodide |
| Synonyms | Tributylsulfoniumiodide tributylsulfonium iodide Tri-n-butylsulfonium iodide TRI-N-BUTYLSULFONIUM IODIDE |
| CAS | 18146-62-8 |
| InChI | InChI=1/C12H27S.HI/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H/q+1;/p-1 |
Tributylsulfoniumiodide - Physico-chemical Properties
| Molecular Formula | C12H27IS |
| Molar Mass | 330.31 |
| Melting Point | 93 °C |
| Solubility | almost transparency in Methanol |
| Appearance | powder to crystal |
| Color | White to Orange to Green |
| Storage Condition | Room Temprature |
Tributylsulfoniumiodide - Introduction
Tributylsulfoniumiodide(Tri-n-butyltin) is an organotin compound. The following is a description of the nature, use, preparation and safety information of Tributylsulfoniumiodide:
Nature:
1. Appearance is colorless or light yellow crystal.
2. Soluble in organic solvents such as ethanol and ether, slightly soluble in water.
3. Stable in the air, but easy to decompose in the sun.
Use:
1. As a chemical reagent, used in organic synthesis reaction.
2. Can be used for the synthesis of organic tin compounds, in the field of organic synthesis has important application value.
3. As an electron transport material in hybrid solar cells.
Method:
The preparation of Tributylsulfoniumiodide is generally carried out by the following steps:
1. Reacting tri-N-butyltin (Tri-n-butyltin) with hydrogen iodide to generate Tributylsulfoniumiodide.
Safety Information:
1. Tributylsulfoniumiodide has certain toxicity, contact or inhalation may cause poisoning.
2. Wear suitable personal protective equipment such as gloves, goggles and protective clothing when using or handling.
3. Avoid contact with skin and eyes, and pay attention to safe operation when using.
4. Storage should be sealed, stored in a dry environment away from light, away from fire and heat sources.
5. After use or disposal, the waste should be properly disposed of in accordance with relevant regulations.
Nature:
1. Appearance is colorless or light yellow crystal.
2. Soluble in organic solvents such as ethanol and ether, slightly soluble in water.
3. Stable in the air, but easy to decompose in the sun.
Use:
1. As a chemical reagent, used in organic synthesis reaction.
2. Can be used for the synthesis of organic tin compounds, in the field of organic synthesis has important application value.
3. As an electron transport material in hybrid solar cells.
Method:
The preparation of Tributylsulfoniumiodide is generally carried out by the following steps:
1. Reacting tri-N-butyltin (Tri-n-butyltin) with hydrogen iodide to generate Tributylsulfoniumiodide.
Safety Information:
1. Tributylsulfoniumiodide has certain toxicity, contact or inhalation may cause poisoning.
2. Wear suitable personal protective equipment such as gloves, goggles and protective clothing when using or handling.
3. Avoid contact with skin and eyes, and pay attention to safe operation when using.
4. Storage should be sealed, stored in a dry environment away from light, away from fire and heat sources.
5. After use or disposal, the waste should be properly disposed of in accordance with relevant regulations.
Last Update：2024-04-09 02:00:43
Supplier List
Product Name: Tributylsulfonium iodide Visit Supplier Webpage Request for quotation
CAS: 18146-62-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18146-62-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Tributylsulfonium iodide Visit Supplier Webpage Request for quotation
CAS: 18146-62-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18146-62-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History