Triipropylphosphinewtinhexane
Tri-i-propylphosphine
CAS: 6476-36-4
Molecular Formula: C9H21P
Triipropylphosphinewtinhexane - Names and Identifiers
| Name | Tri-i-propylphosphine |
| Synonyms | Tri-i-propylphosphine TRI-I-PROPYLPHOSPHINE Triisopropylphosphine TRIISOPROPYLPHOSPHINE PHOSPHORUS TRIISOPROPYL tripropan-2-ylphosphane Tri isopropyl phosphine Triipropylphosphinewtinhexane Triipropylphosphinetechgrmincolorlessliq TripropylphosphineSureSealbottlecolorlessliq |
| CAS | 6476-36-4 |
| EINECS | 229-333-1 |
| InChI | InChI=1/C9H21P/c1-7(2)10(8(3)4)9(5)6/h7-9H,1-6H3 |
Triipropylphosphinewtinhexane - Physico-chemical Properties
| Molecular Formula | C9H21P |
| Molar Mass | 160.24 |
| Density | 0.839g/mLat 25°C(lit.) |
| Boling Point | 81°C22mm Hg(lit.) |
| Flash Point | 1°F |
| Solubility | Soluble in alkanes. |
| Vapor Presure | 1.18mmHg at 25°C |
| Appearance | liquid |
| Color | colorless |
| BRN | 906732 |
| Storage Condition | Flammables area |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.466(lit.) |
Triipropylphosphinewtinhexane - Risk and Safety
| Risk Codes | R17 - Spontaneously flammable in air R34 - Causes burns |
| Safety Description | S17 - Keep away from combustible material. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 2845 4.2/PG 1 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-13-23 |
| HS Code | 29310099 |
| Hazard Class | 4.2 |
| Packing Group | I |
Triipropylphosphinewtinhexane - Introduction
Tri-i-propylphosphine(Tri-i-propylphosphine) is an organic compound with the chemical formula (CH3)3CCH2)2P. Its properties are as follows:
1. Appearance: colorless liquid or solid;
2. odor: has a special odor similar to phosphine (PH3);
3. Melting point: about -86°C;
4. Boiling point: about 105°C.
Tri-i-propylphosphine are mainly used in the field of organic synthesis, specific applications include:
1. As a catalyst: Tri-i-propylphosphine can form complexes with transition metals and participate in different catalytic reactions, such as the synthesis of small organic molecules, polymers and metal organic compounds;
2. As a reducing agent: Tri-i-propylphosphine can convert aldehydes, ketones, esters and acids into corresponding alcohols or alkyl compounds;
3. as a ligand: Tri-i-propylphosphine can coordinate with metal to form stable complexes, which can be used to catalyze different organic synthesis reactions.
A common method of preparing Tri-i-propylphosphine is by reacting isopropanol with trimethylphosphine. The specific preparation steps can refer to the following reaction equation:
(CH3)3COH P(CH3)3 → (CH3)3CCH2)2P CH4
For safety information, detailed safety precautions are provided in the Tri-i-propylphosphine Chemical Safety Technical Instructions. Generally speaking, it is a flammable liquid and should be stored in a well-ventilated place, away from fire and high temperature. When in use, should wear appropriate protective equipment, such as chemical protective glasses, protective gloves and protective clothing. At the same time, contact with oxidants and strong acids should be avoided. In case of leakage, appropriate measures shall be taken promptly to deal with and clean up.
Please note that the above is only general information. The specific use and safe operation should refer to the actual chemical safety technical manual and the correct experimental operation manual.
1. Appearance: colorless liquid or solid;
2. odor: has a special odor similar to phosphine (PH3);
3. Melting point: about -86°C;
4. Boiling point: about 105°C.
Tri-i-propylphosphine are mainly used in the field of organic synthesis, specific applications include:
1. As a catalyst: Tri-i-propylphosphine can form complexes with transition metals and participate in different catalytic reactions, such as the synthesis of small organic molecules, polymers and metal organic compounds;
2. As a reducing agent: Tri-i-propylphosphine can convert aldehydes, ketones, esters and acids into corresponding alcohols or alkyl compounds;
3. as a ligand: Tri-i-propylphosphine can coordinate with metal to form stable complexes, which can be used to catalyze different organic synthesis reactions.
A common method of preparing Tri-i-propylphosphine is by reacting isopropanol with trimethylphosphine. The specific preparation steps can refer to the following reaction equation:
(CH3)3COH P(CH3)3 → (CH3)3CCH2)2P CH4
For safety information, detailed safety precautions are provided in the Tri-i-propylphosphine Chemical Safety Technical Instructions. Generally speaking, it is a flammable liquid and should be stored in a well-ventilated place, away from fire and high temperature. When in use, should wear appropriate protective equipment, such as chemical protective glasses, protective gloves and protective clothing. At the same time, contact with oxidants and strong acids should be avoided. In case of leakage, appropriate measures shall be taken promptly to deal with and clean up.
Please note that the above is only general information. The specific use and safe operation should refer to the actual chemical safety technical manual and the correct experimental operation manual.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Tri-i-propylphosphine Request for quotation
CAS: 6476-36-4
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 6476-36-4
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
Product Name: Tri-i-propylphosphine Request for quotation
CAS: 6476-36-4
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 6476-36-4
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
View History