Trioctylsilane
Trioctylsilane
CAS: 18765-09-8
Molecular Formula: C24H52Si
Trioctylsilane - Names and Identifiers
| Name | Trioctylsilane |
| Synonyms | trioctylsilyl rioctylsilicon trioctyl-silan Trioctylsilane TRIOCTYLSILANE Trioctylsilicon Silane, trioctyl- TRI-N-OCTYLSILANE |
| CAS | 18765-09-8 |
| EINECS | 242-559-5 |
| InChI | InChI=1/C24H51Si/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| InChIKey | JBAALNCKQCMFDH-UHFFFAOYSA-N |
Trioctylsilane - Physico-chemical Properties
| Molecular Formula | C24H52Si |
| Molar Mass | 368.76 |
| Density | 0.821 g/mL at 25 °C (lit.) |
| Boling Point | 163-165 °C/0.15 mmHg (lit.) |
| Flash Point | >230°F |
| Specific Gravity | 0.821 |
| Storage Condition | Room Temprature |
| Sensitive | 3: reacts with aqueous base |
| Refractive Index | n20/D 1.454(lit.) |
Trioctylsilane - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 1 |
| TSCA | Yes |
Trioctylsilane - Introduction
Trioctylsilane, chemical formula C8H19SiH3, is an organosilicon compound. The following is a description of the nature, use, formulation and safety information of Trioctylsilane:
Nature:
1. Appearance: colorless liquid.
2. Melting point and boiling point: melting point is -130 ° C, boiling point is 155 ° C.
3. Density: 0.78g/cm³.
4. Flash point: 27 ° C.
5. Solubility: Soluble in organic solvents, such as ethanol, ether, etc.
Use:
1. Trioctylsilane is commonly used as surfactant, surfactant and lubricant.
2. Because of its long alkyl chain, it has the characteristics of good impurity resistance, so it is often used to add synthetic lubricants, industrial lubricants and greases.
3. Trioctylsilane can also be used to improve the fluidity of certain polymers and improve the flexibility of certain plastics.
Preparation Method:
Trioctylsilane can be synthesized by hydrosilylation. In General, 1-octene can be subjected to an addition reaction with hydrogen in the presence of a strong base to give trioctylsilae.
Safety Information:
1. Trioctylsilane may be irritating to the skin and should be rinsed with plenty of water immediately after contact.
2. Avoid inhaling its vapor or mist, and use appropriate protective equipment, such as respirators and chemical protective clothing.
3. Trioctylsilane should avoid contact with strong oxidants and acids during storage and use to avoid dangerous reactions.
Nature:
1. Appearance: colorless liquid.
2. Melting point and boiling point: melting point is -130 ° C, boiling point is 155 ° C.
3. Density: 0.78g/cm³.
4. Flash point: 27 ° C.
5. Solubility: Soluble in organic solvents, such as ethanol, ether, etc.
Use:
1. Trioctylsilane is commonly used as surfactant, surfactant and lubricant.
2. Because of its long alkyl chain, it has the characteristics of good impurity resistance, so it is often used to add synthetic lubricants, industrial lubricants and greases.
3. Trioctylsilane can also be used to improve the fluidity of certain polymers and improve the flexibility of certain plastics.
Preparation Method:
Trioctylsilane can be synthesized by hydrosilylation. In General, 1-octene can be subjected to an addition reaction with hydrogen in the presence of a strong base to give trioctylsilae.
Safety Information:
1. Trioctylsilane may be irritating to the skin and should be rinsed with plenty of water immediately after contact.
2. Avoid inhaling its vapor or mist, and use appropriate protective equipment, such as respirators and chemical protective clothing.
3. Trioctylsilane should avoid contact with strong oxidants and acids during storage and use to avoid dangerous reactions.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Trioctylsilane Visit Supplier Webpage Request for quotation
CAS: 18765-09-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18765-09-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Trioctylsilane Visit Supplier Webpage Request for quotation
CAS: 18765-09-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18765-09-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History