Z-Abu-OH

Z-Abu-OH - Names and Identifiers

Name	Z-Abu-OH
Synonyms	Z-D-Abu Z-Abu-OH Z-L-Abu-OH Z-2-ABU-OH Cbz-2-Abu-OH Z-L-α-aminobutyric acid (S)-Cbz-2-aMinobutyric acid (S)-Cbz-2-aminobutyric acid BENZYLOXYCARBONYL-L-2-AMINOBUTYRIC ACID 2-{[(benzyloxy)carbonyl]amino}butanoic acid (2S)-2-{[(benzyloxy)carbonyl]amino}butanoic acid
CAS	42918-86-5
EINECS	1533716-785-6
InChI	InChI=1/C12H15NO4/c1-2-10(11(14)15)13-12(16)17-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,13,16)(H,14,15)/t10-/m0/s1

Z-Abu-OH - Physico-chemical Properties

Molecular Formula	C12H15NO4
Molar Mass	237.25
Density	1.213g/cm³
Boling Point	430.3°C at 760 mmHg
Flash Point	214°C
Vapor Presure	3.61E-08mmHg at 25°C
Storage Condition	Sealed in dry,2-8°C
Refractive Index	1.538

Z-Abu-OH - Introduction

Z-Abu-OH (Z-Abu-OH) is an organic compound with the following properties:

1. Appearance: colorless solid
2. molecular formula: C12H17NO3
3. Molecular weight: 227.27g/mol
4. Melting point: 79-83°C
5. solubility: soluble in organic solvents such as methanol and dichloromethane, insoluble in water.

Z-Abu-OH are mainly used to prepare peptide compounds or as precursors of inhibitors. It is a commonly used protecting group, in the synthesis of peptide chain can be on the nitrogen terminal amino protection, in order to avoid unnecessary reaction.

Z-Abu-OH preparation method is relatively simple, mainly through the following steps:

1. L-phenylalanine and tert-butoxycarbonyl isocyanate are reacted under alkaline conditions to produce tert-butoxycarbonyl phenylalanine.
2. The compound generated in the previous step is reacted with benzyl alcohol under acidic conditions to generate Z-Abu-OH.

Regarding safety information, the toxicity and danger of Z-Abu-OH are low, but the following should be noted:

1. avoid contact with skin, if contact with skin, should immediately rinse with plenty of water.
2. avoid inhaling its dust or vapor, and operate in a well-ventilated place.
3. storage should be sealed, away from the fire and oxidant.

Last Update：2024-04-10 22:29:15