Z-D-Met-OH
Z-D-Met-OH
CAS: 28862-80-8
Molecular Formula: C13H17NO4S
Z-D-Met-OH - Names and Identifiers
| Name | Z-D-Met-OH |
| Synonyms | z-D-Met Z-D-MET-OH Z-D-Met-OH Z-D-METHIONINE Cbz-D-methionine N-CBZ-D-METHIONINE Z-D-METHIONINE extrapure N-ALPHA-CBZ-D-METHIONINE N-CARBOBENZOXY-D-METHIONINE N-Carbobenzoxy-D-methionine N-Benzyloxycarbonyl-D-methionine N-ALPHA-CARBOBENZOXY-D-METHIONINE N-ALPHA-BENZYLOXYCARBONYL-D-METHIONINE |
| CAS | 28862-80-8 |
| InChI | InChI=1/C13H17NO4S/c1-19-8-7-11(12(15)16)14-13(17)18-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,17)(H,15,16)/t11-/m1/s1 |
Z-D-Met-OH - Physico-chemical Properties
| Molecular Formula | C13H17NO4S |
| Molar Mass | 283.34 |
| Density | 1.253 |
| Melting Point | 67-69°C |
| Boling Point | 504.7°C at 760 mmHg |
| Flash Point | 259°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 5.22E-11mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 26 ° (C=1, MeOH) |
| MDL | MFCD00026043 |
Z-D-Met-OH - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| HS Code | 29225090 |
Z-D-Met-OH - Introduction
Z-D-Met-OH(Z-D-Met-OH) is an organic compound with the following properties:
1. Appearance: white crystal or crystalline powder.
2. Molecular formula: C12H15NO4.
3. Molecular Weight: 237.25.
4. Melting Point: the degree varies with the structure and purity of the sample.
5. Solubility: Soluble in some organic solvents and water.
The use of Z-D-Met-OH mainly has the following aspects:
1. Biomedical research: As an important intermediate for the synthesis of peptides and proteins, it can be used in the fields of drug development, biological research and protein engineering.
2. Medicinal chemistry: in medicinal chemistry, Z-D-Met-OH can be used to synthesize biologically active compounds, such as peptide drugs and enzyme inhibitors.
3. Industrial applications: Z-D-Met-OH can also be used in organic synthesis reactions, for example, as initiators in the polymer industry.
The method of preparing Z-D-Met-OH is usually as follows:
N-benzyloxycarbonyl-L-methionine (Z-L-Met-OH) is reacted with an acid by heating to selectively deprotect the benzyl group on the hydroxyl group to form the target product Z-D-Met-OH. Specific reaction conditions and operation methods can be adjusted according to different experimental requirements.
For Z-D-Met-OH safety information, please refer to the following recommendations:
1. It should be operated in a well-ventilated place and avoid dust.
2. Use personal protective equipment such as gloves, goggles, and lab coats.
3. Avoid contact with skin and eyes, such as contact, immediately rinse with plenty of water.
4. If inhaled or eaten, should be timely medical treatment.
In addition, this safety information is general, and specific safety practice recommendations and risk assessments should refer to the safety data sheet (SDS) of the relevant chemical.
1. Appearance: white crystal or crystalline powder.
2. Molecular formula: C12H15NO4.
3. Molecular Weight: 237.25.
4. Melting Point: the degree varies with the structure and purity of the sample.
5. Solubility: Soluble in some organic solvents and water.
The use of Z-D-Met-OH mainly has the following aspects:
1. Biomedical research: As an important intermediate for the synthesis of peptides and proteins, it can be used in the fields of drug development, biological research and protein engineering.
2. Medicinal chemistry: in medicinal chemistry, Z-D-Met-OH can be used to synthesize biologically active compounds, such as peptide drugs and enzyme inhibitors.
3. Industrial applications: Z-D-Met-OH can also be used in organic synthesis reactions, for example, as initiators in the polymer industry.
The method of preparing Z-D-Met-OH is usually as follows:
N-benzyloxycarbonyl-L-methionine (Z-L-Met-OH) is reacted with an acid by heating to selectively deprotect the benzyl group on the hydroxyl group to form the target product Z-D-Met-OH. Specific reaction conditions and operation methods can be adjusted according to different experimental requirements.
For Z-D-Met-OH safety information, please refer to the following recommendations:
1. It should be operated in a well-ventilated place and avoid dust.
2. Use personal protective equipment such as gloves, goggles, and lab coats.
3. Avoid contact with skin and eyes, such as contact, immediately rinse with plenty of water.
4. If inhaled or eaten, should be timely medical treatment.
In addition, this safety information is general, and specific safety practice recommendations and risk assessments should refer to the safety data sheet (SDS) of the relevant chemical.
Last Update：2024-04-10 22:41:30
Supplier List
Spot supply
Product Name: N-Cbz-D-Methionine Visit Supplier Webpage Request for quotationCAS: 28862-80-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: N-Cbz-D-Methionine Visit Supplier Webpage Request for quotationCAS: 28862-80-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History