Z-GLY-GLY-OET
Z-GLY-GLY-OET
CAS: 1145-81-9
Molecular Formula: C12H15NO4
Z-GLY-GLY-OET - Names and Identifiers
| Name | Z-GLY-GLY-OET |
| Synonyms | Z-GLY-GLY-OET CBZ-Glycine ethyl ester N-Cbz-glycine Ethyl Ester Z-GLYCYL GLYCINE ETHYL ESTER ethyl N-[(benzyloxy)carbonyl]glycinate |
| CAS | 1145-81-9 |
| EINECS | 807-876-0 |
| InChI | InChI=1/C12H15NO4/c1-2-16-11(14)8-13-12(15)17-9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,15) |
Z-GLY-GLY-OET - Physico-chemical Properties
| Molecular Formula | C12H15NO4 |
| Molar Mass | 237.25 |
| Density | 1.162g/cm3 |
| Melting Point | 81-82℃ |
| Boling Point | 376.3°C at 760 mmHg |
| Flash Point | 181.4°C |
| Vapor Presure | 7.32E-06mmHg at 25°C |
| pKa | 10.97±0.46(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.514 |
Z-GLY-GLY-OET - Upstream Downstream Industry
| Downstream Products | Ethyl N-Cbz-4-Oxopyrrolidine-3-carboxylate Z-GLY-NH2 |
Z-GLY-GLY-OET - Introduction
N-Cbz ethyl ester (N-Cbz-glycine ester) is an organic compound with the following properties:
1. Appearance: Usually a white crystalline solid.
2. solubility: soluble in some organic solvents, such as alcohols, ethers and chlorinated hydrocarbons, and low solubility in water.
3. melting point: about 80-85 ℃.
N-Cbz-glycine ethyl ester is mainly used as a protective group in organic synthesis reactions, and is commonly used in the synthesis of amino acids, peptides and drugs. It can be used as a protective functional group, while selectively protecting the amino group (especially the α-amino group), other functional groups are not disturbed. Specific reaction pathways and product selection can be controlled in organic synthesis by using N-Cbz-glycine ethyl ester.
A common method for preparing N-Cbz-glycine ethyl ester is to react the N-protecting group of glycine with acetic anhydride. The reaction is usually carried out at room temperature under basic conditions. After completion of the reaction, the product can be purified by crystallization or column chromatography.
When using N-Cbz-glycine ethyl ester, the following safety information should be noted:
1. N-Cbz-glycine ethyl ester is an organic compound, which has certain toxicity, so direct contact with skin, eyes or inhalation of its dust should be avoided.
2. Wear appropriate personal protective equipment such as lab gloves, glasses, and laboratory clothing during use and operation.
3. When using N-Cbz-glycine ethyl ester in a laboratory environment, follow laboratory safety regulations and operating specifications, and provide adequate ventilation.
4. Please store N-Cbz-glycine ethyl ester in a sealed container, away from fire and oxidizing agents.
1. Appearance: Usually a white crystalline solid.
2. solubility: soluble in some organic solvents, such as alcohols, ethers and chlorinated hydrocarbons, and low solubility in water.
3. melting point: about 80-85 ℃.
N-Cbz-glycine ethyl ester is mainly used as a protective group in organic synthesis reactions, and is commonly used in the synthesis of amino acids, peptides and drugs. It can be used as a protective functional group, while selectively protecting the amino group (especially the α-amino group), other functional groups are not disturbed. Specific reaction pathways and product selection can be controlled in organic synthesis by using N-Cbz-glycine ethyl ester.
A common method for preparing N-Cbz-glycine ethyl ester is to react the N-protecting group of glycine with acetic anhydride. The reaction is usually carried out at room temperature under basic conditions. After completion of the reaction, the product can be purified by crystallization or column chromatography.
When using N-Cbz-glycine ethyl ester, the following safety information should be noted:
1. N-Cbz-glycine ethyl ester is an organic compound, which has certain toxicity, so direct contact with skin, eyes or inhalation of its dust should be avoided.
2. Wear appropriate personal protective equipment such as lab gloves, glasses, and laboratory clothing during use and operation.
3. When using N-Cbz-glycine ethyl ester in a laboratory environment, follow laboratory safety regulations and operating specifications, and provide adequate ventilation.
4. Please store N-Cbz-glycine ethyl ester in a sealed container, away from fire and oxidizing agents.
Last Update：2024-04-09 21:21:28
Supplier List
View History
Downstream Products for Z-GLY-GLY-OET