alpha-Chloro-N,N-diethylpropionamide
2-chloro-N,N-diethylpropionamide
CAS: 54333-75-4
Molecular Formula: C7H14ClNO
alpha-Chloro-N,N-diethylpropionamide - Names and Identifiers
| Name | 2-chloro-N,N-diethylpropionamide |
| Synonyms | 2-chloro-N,N-diethylpropanamide 2-Chloro-N,N-diethylpropionamide 2-chloro-N,N-diethylpropionamide N,N-Diethyl-2-chloropropionamide Propanamide, 2-chloro-N,N-diethyl- alpha-Chloro-N,N-diethylpropionamide |
| CAS | 54333-75-4 |
| EINECS | 259-107-8 |
| InChI | InChI=1/C7H14ClNO/c1-4-9(5-2)7(10)6(3)8/h6H,4-5H2,1-3H3 |
alpha-Chloro-N,N-diethylpropionamide - Physico-chemical Properties
| Molecular Formula | C7H14ClNO |
| Molar Mass | 163.65 |
| Density | 1.021 |
| Boling Point | 217 °C |
| Flash Point | 85 °C |
| Vapor Presure | 0.137mmHg at 25°C |
| pKa | -0.89±0.70(Predicted) |
| Refractive Index | 1.449 |
| Physical and Chemical Properties | This product is a colorless liquid, miscible with most organic solvents. |
alpha-Chloro-N,N-diethylpropionamide - Reference Information
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | N, N-diethyl-2-chloropropanamide is an intermediate of the herbicide dimethamine. |
| production method | its preparation method is to add solvent toluene and 2-chloropropionic acid to the reaction kettle, heat azeotropic dehydration, after the water is removed, drop a certain amount of phosphorus oxychloride and diethylamine for acylation reaction, the reaction temperature is 115~120 ℃, after the reaction is over, the phosphorous acid is washed off with water, and the organic layer is desolubilized to obtain the product. |
Last Update：2024-04-09 21:54:55
