alpha-Cyclohexylcyclohexanemethanol
Dicyclohexylmethanol
CAS: 4453-82-1
Molecular Formula: C13H24O
alpha-Cyclohexylcyclohexanemethanol - Names and Identifiers
| Name | Dicyclohexylmethanol |
| Synonyms | AI3-05548 Dicyclhexylmethanol DICYCLOHEXYLMETHANOL DICYCLOHEXYLCARBINOL Dicyclohexylmethanol Dicyclohexylcarbinol Dicycloverine Impurity 8 α-Cyclohexylcyclohexanemethanol alpha-Cyclohexylcyclohexanemethanol alpha-cyclohexylcyclohexanemethanol Cyclohexanemethanol, alpha-cyclohexyl- |
| CAS | 4453-82-1 |
| EINECS | 224-695-7 |
| InChI | InChI=1/C13H24O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-14H,1-10H2 |
alpha-Cyclohexylcyclohexanemethanol - Physico-chemical Properties
| Molecular Formula | C13H24O |
| Molar Mass | 196.33 |
| Density | 0.8924 (rough estimate) |
| Melting Point | 58-64°C(lit.) |
| Boling Point | 154°C12mm Hg(lit.) |
| Flash Point | 153-155°C/12mm |
| Solubility | methanol: 0.1g/mL, clear |
| Vapor Presure | 0.000894mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| BRN | 1926669 |
| pKa | 15.17±0.20(Predicted) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.4790 (estimate) |
| MDL | MFCD00001474 |
alpha-Cyclohexylcyclohexanemethanol - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
alpha-Cyclohexylcyclohexanemethanol - Introduction
Dicyclohexylmethanol is an organic compound with the chemical formula C13H26O. The following is a description of the nature, use, preparation and safety information of the Dicyclohexylmethanol:
Nature:
1. appearance: the Dicyclohexylmethanol is colorless to light yellow liquid.
2. solubility: it can be dissolved in common organic solvents, such as ethanol, dimethyl methanol and ethers.
3. Melting point and boiling point: The melting point of Dicyclohexylmethanol is about -4 degrees Celsius, and the boiling point is about 260-280 degrees Celsius.
4. Stability: It is relatively stable under conventional storage conditions, but high temperatures and strong oxidants should be avoided.
Use:
1. As a solvent: Due to its good solubility, Dicyclohexylmethanol is often used as an organic solvent in the laboratory.
2. chemical intermediates: Dicyclohexylmethanol can be used to synthesize other compounds, such as heterocyclic compounds, rubber additives.
Preparation Method:
Dicyclohexylmethanol can be prepared by reacting cyclohexane and methanol in the presence of a catalyst. Specific preparation methods include catalytic cracking, redox reaction, etc.
Safety Information:
1. toxicity: Dicyclohexylmethanol has certain toxicity to human body. Care should be taken to avoid direct contact with the skin, eyes and respiratory system.
2. fire hazard: Dicyclohexylmethanol flammable, should avoid contact with open flame and high temperature.
3. Storage: Dicyclohexylmethanol should be stored in a dark, cool and well-ventilated place.
4. Handling: When handling the compound, follow correct laboratory procedures and use appropriate personal protective equipment.
Please note that safe handling and proper storage are very important when using any compound. If more detailed information is required, please refer to the relevant safety data sheet or consult a professional.
Nature:
1. appearance: the Dicyclohexylmethanol is colorless to light yellow liquid.
2. solubility: it can be dissolved in common organic solvents, such as ethanol, dimethyl methanol and ethers.
3. Melting point and boiling point: The melting point of Dicyclohexylmethanol is about -4 degrees Celsius, and the boiling point is about 260-280 degrees Celsius.
4. Stability: It is relatively stable under conventional storage conditions, but high temperatures and strong oxidants should be avoided.
Use:
1. As a solvent: Due to its good solubility, Dicyclohexylmethanol is often used as an organic solvent in the laboratory.
2. chemical intermediates: Dicyclohexylmethanol can be used to synthesize other compounds, such as heterocyclic compounds, rubber additives.
Preparation Method:
Dicyclohexylmethanol can be prepared by reacting cyclohexane and methanol in the presence of a catalyst. Specific preparation methods include catalytic cracking, redox reaction, etc.
Safety Information:
1. toxicity: Dicyclohexylmethanol has certain toxicity to human body. Care should be taken to avoid direct contact with the skin, eyes and respiratory system.
2. fire hazard: Dicyclohexylmethanol flammable, should avoid contact with open flame and high temperature.
3. Storage: Dicyclohexylmethanol should be stored in a dark, cool and well-ventilated place.
4. Handling: When handling the compound, follow correct laboratory procedures and use appropriate personal protective equipment.
Please note that safe handling and proper storage are very important when using any compound. If more detailed information is required, please refer to the relevant safety data sheet or consult a professional.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Dicyclohexylmethanol Visit Supplier Webpage Request for quotation
CAS: 4453-82-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4453-82-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Dicyclohexylmethanol Visit Supplier Webpage Request for quotation
CAS: 4453-82-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4453-82-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History