benzene-1,3-dithiol
benzene-1,3-dithiol
CAS: 626-04-0
Molecular Formula: C6H6S2
benzene-1,3-dithiol - Names and Identifiers
| Name | benzene-1,3-dithiol |
| Synonyms | M-BDT 1,3-Benzedithiol Dithioresorcinol 1,3-BENZENEDITHIOL 1,3-Benzenedithiol BENZENE-1,3-DITHIOL benzene-1,3-dithiol 1,3-BENZENEDITHIOLE 1,3-DIMERCAPTOBENZENE 1,3-Dimercaptobenzene~Dithioresorcinol |
| CAS | 626-04-0 |
| EINECS | 210-925-3 |
| InChI | InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
benzene-1,3-dithiol - Physico-chemical Properties
| Molecular Formula | C6H6S2 |
| Molar Mass | 142.24 |
| Density | 1.24 |
| Melting Point | 24-25°C(lit.) |
| Boling Point | 128-129°C16mm Hg(lit.) |
| Flash Point | >230°F |
| Solubility | Miscible with acetonitrile. |
| Vapor Presure | 0.0477mmHg at 25°C |
| Appearance | solid |
| Color | White or Colorless to Light yellow |
| BRN | 1634412 |
| pKa | 5.84±0.10(Predicted) |
| Sensitive | Air Sensitive |
| Refractive Index | 1.6625 |
benzene-1,3-dithiol - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| UN IDs | UN 3335 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 9-13 |
| Packing Group | III |
benzene-1,3-dithiol - Introduction
benzene 1,3-dithiol is an organic compound with the chemical formula C6H4S2. Its main properties are as follows:
1. Appearance: benzene-1,3-dithiol is a white or pale yellow crystalline solid.
2. Solubility: It is soluble in organic solvents such as alcohols, ethers and ketones, but insoluble in water.
3. odor: benzene-1,3-dithiol has a pungent odor.
benzene-1,3-dithiol has several important uses in chemistry and industry, including:
1. Metal corrosion inhibitor: It can be used as a metal surface treatment agent to inhibit the occurrence of metal corrosion.
2. Reducing agent in chemical reaction: benzene-1,3-dithiol can be used as reducing agent in chemical reaction and participate in many organic and inorganic reactions.
3. chemical analysis reagent: it is widely used in organic and inorganic analysis reagent.
The preparation method of benzene-1,3-dithiol includes:
1. Through the reduction of benzoisothiocyanate: The reaction of benzoisothiocyanate with a reducing agent (such as hydrogen or sulfinic acid) can obtain benzene-1,3-dithiol.
2. through the reaction of 1,3-dibromobenzene and sulfur: 1,3-dibromobenzene can also react with sulfur to synthesize benzene-1,3-dithiol.
When using benzene-1,3-dithiol, you need to pay attention to safety matters:
1. It is irritating, and contact with skin and eyes can cause irritation and allergic reactions, so protective gloves and goggles should be worn during operation.
2. avoid inhalation of its dust or gas, should be in a well-ventilated place to operate.
3. Do not contact with strong oxidants, acids, bases or other substances that are prone to reaction.
4. storage should be sealed, away from the fire and heat source.
In summary, benzene-1,3-dithiol is an organic compound with certain chemical properties and a wide range of uses, but it is necessary to pay attention to safe operation during use.
1. Appearance: benzene-1,3-dithiol is a white or pale yellow crystalline solid.
2. Solubility: It is soluble in organic solvents such as alcohols, ethers and ketones, but insoluble in water.
3. odor: benzene-1,3-dithiol has a pungent odor.
benzene-1,3-dithiol has several important uses in chemistry and industry, including:
1. Metal corrosion inhibitor: It can be used as a metal surface treatment agent to inhibit the occurrence of metal corrosion.
2. Reducing agent in chemical reaction: benzene-1,3-dithiol can be used as reducing agent in chemical reaction and participate in many organic and inorganic reactions.
3. chemical analysis reagent: it is widely used in organic and inorganic analysis reagent.
The preparation method of benzene-1,3-dithiol includes:
1. Through the reduction of benzoisothiocyanate: The reaction of benzoisothiocyanate with a reducing agent (such as hydrogen or sulfinic acid) can obtain benzene-1,3-dithiol.
2. through the reaction of 1,3-dibromobenzene and sulfur: 1,3-dibromobenzene can also react with sulfur to synthesize benzene-1,3-dithiol.
When using benzene-1,3-dithiol, you need to pay attention to safety matters:
1. It is irritating, and contact with skin and eyes can cause irritation and allergic reactions, so protective gloves and goggles should be worn during operation.
2. avoid inhalation of its dust or gas, should be in a well-ventilated place to operate.
3. Do not contact with strong oxidants, acids, bases or other substances that are prone to reaction.
4. storage should be sealed, away from the fire and heat source.
In summary, benzene-1,3-dithiol is an organic compound with certain chemical properties and a wide range of uses, but it is necessary to pay attention to safe operation during use.
Last Update：2024-04-10 22:29:15
