benzoylnitromethane
benzoylnitromethane
CAS: 614-21-1
Molecular Formula: C8H7NO3
benzoylnitromethane - Names and Identifiers
| Name | benzoylnitromethane |
| Synonyms | NSC 4509 AKOS B022283 benzoylnitromethane BENZOYLNITROMETHANE ALPHA-NITROACETOPHENONE 2-Nitro-1-phenylethanone Ethanone, 2-nitro-1-phenyl- Benzoylnitromethanealpha-Nitroacetophenone |
| CAS | 614-21-1 |
| InChI | InChI=1/C8H7NO3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2 |
benzoylnitromethane - Physico-chemical Properties
| Molecular Formula | C8H7NO3 |
| Molar Mass | 165.15 |
| Density | 1.3450 (rough estimate) |
| Melting Point | 105-107 °C (lit.) |
| Boling Point | 292.97°C (rough estimate) |
| Appearance | Liquid |
| Color | Clear colorless or yellow to red to brown |
| pKa | 5.37±0.29(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.5468 (estimate) |
benzoylnitromethane - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29147000 |
benzoylnitromethane - Introduction
benzoylnitromethane(benzoylnitromethane) is an organic compound with the chemical formula C7H5NO4. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: The benzoylnitromethane is a colorless to light yellow crystalline solid.
2. Melting point: about 100-101°C.
3. Boiling point: about 270-280°C.
4. Solubility: The compound is soluble in organic solvents such as ethanol, benzene and dichloromethane, and slightly soluble in water.
Use:
1. synthetic intermediates: benzoylnitromethane, as an organic synthesis intermediate, is widely used in organic synthesis reactions.
2. Chemical reagent: It can be used as some chemical reagents, such as nitric acid acidification agent and esterification reagent of hydroxamic acid.
3. Explosive raw materials: benzoylnitromethane can also be used as explosive raw materials, although its use is subject to certain restrictions due to its flammability and explosiveness.
Preparation Method:
benzoylnitromethane can be obtained by the reaction of benzoyl chloride and methyl nitrate. The reaction is usually carried out at a low temperature to control the occurrence of side reactions.
Safety Information:
1. Because the benzoylnitromethane is flammable and explosive, it needs to be handled carefully during use and storage to avoid contact with heat sources, open flames, etc.
2. The compound is irritating to the eyes, skin and respiratory tract. Protective equipment should be used to ensure that the operation is carried out in a well-ventilated environment.
3. If a large amount of benzoylnitromethane is ingested or inhaled, seek medical attention immediately.
4. When storing, the benzoylnitromethane should be stored separately from other chemical substances to avoid unnecessary reactions and accidents.
Nature:
1. Appearance: The benzoylnitromethane is a colorless to light yellow crystalline solid.
2. Melting point: about 100-101°C.
3. Boiling point: about 270-280°C.
4. Solubility: The compound is soluble in organic solvents such as ethanol, benzene and dichloromethane, and slightly soluble in water.
Use:
1. synthetic intermediates: benzoylnitromethane, as an organic synthesis intermediate, is widely used in organic synthesis reactions.
2. Chemical reagent: It can be used as some chemical reagents, such as nitric acid acidification agent and esterification reagent of hydroxamic acid.
3. Explosive raw materials: benzoylnitromethane can also be used as explosive raw materials, although its use is subject to certain restrictions due to its flammability and explosiveness.
Preparation Method:
benzoylnitromethane can be obtained by the reaction of benzoyl chloride and methyl nitrate. The reaction is usually carried out at a low temperature to control the occurrence of side reactions.
Safety Information:
1. Because the benzoylnitromethane is flammable and explosive, it needs to be handled carefully during use and storage to avoid contact with heat sources, open flames, etc.
2. The compound is irritating to the eyes, skin and respiratory tract. Protective equipment should be used to ensure that the operation is carried out in a well-ventilated environment.
3. If a large amount of benzoylnitromethane is ingested or inhaled, seek medical attention immediately.
4. When storing, the benzoylnitromethane should be stored separately from other chemical substances to avoid unnecessary reactions and accidents.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Benzoylnitromethane Visit Supplier Webpage Request for quotation
CAS: 614-21-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 614-21-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Benzoylnitromethane Visit Supplier Webpage Request for quotation
CAS: 614-21-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 614-21-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History