cis-4-Methylcyclohexanol
cis-4-Methylcyclohexanol
CAS: 7731-28-4
Molecular Formula: C7H14O
cis-4-Methylcyclohexanol - Names and Identifiers
| Name | cis-4-Methylcyclohexanol |
| Synonyms | cis-4-Methylhexalin cis-Hexahydro-p-cresol cis-4-Methylcyclohexanol CIS-4-METHYLCYCLOHEXANOL 4β-Methyl-1β-cyclohexanol 4-methyl cyclohexanol, cis cis-4-Methylcyclohexan-1-ol Cyclohexanol, 4-methyl-, cis- |
| CAS | 7731-28-4 |
| EINECS | 231-789-1 |
| InChI | InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7+ |
cis-4-Methylcyclohexanol - Physico-chemical Properties
| Molecular Formula | C7H14O |
| Molar Mass | 114.19 |
| Density | 0,917 g/cm3 |
| Melting Point | -10°C |
| Boling Point | 172-173°C |
| Flash Point | 70°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.475mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| pKa | 15.32±0.40(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4610 |
| MDL | MFCD00064170 |
cis-4-Methylcyclohexanol - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S38 - In case of insufficient ventilation, wear suitable respiratory equipment. |
cis-4-Methylcyclohexanol - Introduction
cis-4-Methylcyclohexanol is an organic compound with the molecular formula C7H14O. It has the following properties:
1. appearance and smell: color less transparent liquid, with sweet smell.
2. Solubility: Soluble in most organic solvents, such as alcohols, ethers and esters, but insoluble in water.
3. density: relative density is about 0.849 g/cm ^ 3.
4. Boiling point: about 172-174°C.
5. Ignition point: about 74°C.
The main uses of cis-4-Methylcyclohexanol are as follows:
1. chemical synthesis: can be used as a raw material for organic synthesis, used in the synthesis of other compounds, such as aldehyde alcohol, ester, etc.
2. Solvent: Due to its good solubility, it can be used as a component of some organic solvents.
3. Pharmaceutical field: The compound can be used as a synthetic intermediate of antibiotics, drugs and fluorescent agents.
There are several main methods for preparing cis-4-Methylcyclohexanol:
1. Reaction of cyclohexene with sodium bisulfite: The target product can be obtained by reacting cyclohexene with sodium bisulfite under appropriate conditions and then dehydrating.
2. Oxidation reaction: cis-4-Methylcyclohexanol can be obtained by an oxidation reaction of cyclohexene.
Pay attention to the following safety information when using and handling cis-4-Methylcyclohexanol:
1. Avoid direct contact: Avoid direct contact with skin, eyes and respiratory tract, and wear appropriate protective clothing and gloves.
2. Good ventilation: When operating the compound, ensure that there is sufficient ventilation in the room to avoid its concentration exceeding the safe range.
3. fire and explosion-proof: This compound is flammable and should be kept away from open flames and high temperatures to avoid fire and explosion.
4. Storage and handling: It should be stored in a sealed container, away from oxidants and fire sources. Relevant regulations and operating procedures should be observed when handling waste to ensure safe handling.
1. appearance and smell: color less transparent liquid, with sweet smell.
2. Solubility: Soluble in most organic solvents, such as alcohols, ethers and esters, but insoluble in water.
3. density: relative density is about 0.849 g/cm ^ 3.
4. Boiling point: about 172-174°C.
5. Ignition point: about 74°C.
The main uses of cis-4-Methylcyclohexanol are as follows:
1. chemical synthesis: can be used as a raw material for organic synthesis, used in the synthesis of other compounds, such as aldehyde alcohol, ester, etc.
2. Solvent: Due to its good solubility, it can be used as a component of some organic solvents.
3. Pharmaceutical field: The compound can be used as a synthetic intermediate of antibiotics, drugs and fluorescent agents.
There are several main methods for preparing cis-4-Methylcyclohexanol:
1. Reaction of cyclohexene with sodium bisulfite: The target product can be obtained by reacting cyclohexene with sodium bisulfite under appropriate conditions and then dehydrating.
2. Oxidation reaction: cis-4-Methylcyclohexanol can be obtained by an oxidation reaction of cyclohexene.
Pay attention to the following safety information when using and handling cis-4-Methylcyclohexanol:
1. Avoid direct contact: Avoid direct contact with skin, eyes and respiratory tract, and wear appropriate protective clothing and gloves.
2. Good ventilation: When operating the compound, ensure that there is sufficient ventilation in the room to avoid its concentration exceeding the safe range.
3. fire and explosion-proof: This compound is flammable and should be kept away from open flames and high temperatures to avoid fire and explosion.
4. Storage and handling: It should be stored in a sealed container, away from oxidants and fire sources. Relevant regulations and operating procedures should be observed when handling waste to ensure safe handling.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: Cis-4-Methylcyclohexanol Visit Supplier Webpage Request for quotation
CAS: 7731-28-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 7731-28-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Cis-4-Methylcyclohexanol Visit Supplier Webpage Request for quotation
CAS: 7731-28-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 7731-28-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History