dichloro(prop-2-en-1-yl)silane
Allyldichlorosilane
CAS: 3937-28-8
Molecular Formula: C3H6Cl2Si
dichloro(prop-2-en-1-yl)silane - Names and Identifiers
| Name | Allyldichlorosilane |
| Synonyms | ALLYLDICHLOROSILANE Allyldichlorosilane 2-Propenyldichlorosilane dichloro(prop-2-en-1-yl)silyl dichloro(prop-2-en-1-yl)silane |
| CAS | 3937-28-8 |
| EINECS | 223-515-4 |
| InChI | InChI=1/C3H5Cl2Si/c1-2-3-6(4)5/h2H,1,3H2 |
dichloro(prop-2-en-1-yl)silane - Physico-chemical Properties
| Molecular Formula | C3H6Cl2Si |
| Molar Mass | 141.07 |
| Density | 1.08 |
| Melting Point | <0°C |
| Boling Point | 97 °C |
| Flash Point | -4°C |
| Specific Gravity | 1.08 |
| Sensitive | 8: reacts rapidly with moisture, water, protic solvents |
| Refractive Index | 1.4402 |
dichloro(prop-2-en-1-yl)silane - Risk and Safety
| Risk Codes | R11 - Highly Flammable R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2985 |
| TSCA | No |
dichloro(prop-2-en-1-yl)silane - Introduction
Allyldichlorosilane, the chemical formula is CH3CH = CHCH2SiCl2, which is an organosilicon compound. Its nature is as follows:
1. Appearance: colorless transparent liquid.
2. solubility: soluble in organic solvents, such as petroleum ether, benzene, etc.
3. Melting point:-95°C
4. Boiling point: 149-150°C
5. relative density: 1.051-1.053(20 c)
6. Molecular weight: 129.09g/mol
Allyldichlorosilane has a wide range of applications in organic synthesis, especially in the synthesis of organosilicon compounds. It can be used as a reagent, catalyst and intermediate in organic synthesis. Some common applications include:
1. Synthesis and modification of organic silicon compounds.
2. Preparation of functional silane compounds, such as silicone oil and silicone rubber.
3. as a reagent and intermediate in organic synthesis.
Allyldichlorosilane can be prepared by a variety of methods, common methods include:
1. allyl alcohol and silicon tetrachloride react, and then use acid hydrolysis to obtain the product.
2. The silicon wafer is reacted with enacetone, and then the product is obtained by acidic hydrolysis.
Because the Allyldichlorosilane is an organic compound, the following safety precautions should be paid attention to when using:
1. Avoid contact with skin and eyes. In case of accidental contact, rinse immediately with plenty of water and seek medical help.
2. Use should wear appropriate protective gloves, glasses and protective clothing.
3. Use in a well-ventilated place and avoid inhaling its vapor.
4. should be stored away from fire and high temperature, stored in a cool and dry place.
5. Do not mix Allyldichlorosilane with strong oxidizing substances such as oxidizing agents or chlorinating agents to avoid dangerous reactions.
1. Appearance: colorless transparent liquid.
2. solubility: soluble in organic solvents, such as petroleum ether, benzene, etc.
3. Melting point:-95°C
4. Boiling point: 149-150°C
5. relative density: 1.051-1.053(20 c)
6. Molecular weight: 129.09g/mol
Allyldichlorosilane has a wide range of applications in organic synthesis, especially in the synthesis of organosilicon compounds. It can be used as a reagent, catalyst and intermediate in organic synthesis. Some common applications include:
1. Synthesis and modification of organic silicon compounds.
2. Preparation of functional silane compounds, such as silicone oil and silicone rubber.
3. as a reagent and intermediate in organic synthesis.
Allyldichlorosilane can be prepared by a variety of methods, common methods include:
1. allyl alcohol and silicon tetrachloride react, and then use acid hydrolysis to obtain the product.
2. The silicon wafer is reacted with enacetone, and then the product is obtained by acidic hydrolysis.
Because the Allyldichlorosilane is an organic compound, the following safety precautions should be paid attention to when using:
1. Avoid contact with skin and eyes. In case of accidental contact, rinse immediately with plenty of water and seek medical help.
2. Use should wear appropriate protective gloves, glasses and protective clothing.
3. Use in a well-ventilated place and avoid inhaling its vapor.
4. should be stored away from fire and high temperature, stored in a cool and dry place.
5. Do not mix Allyldichlorosilane with strong oxidizing substances such as oxidizing agents or chlorinating agents to avoid dangerous reactions.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: ALLYLDICHLOROSILANE Visit Supplier Webpage Request for quotation
CAS: 3937-28-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 3937-28-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: ALLYLDICHLOROSILANE Visit Supplier Webpage Request for quotation
CAS: 3937-28-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 3937-28-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History