dimethoxy(prop-2-en-1-yl)silane
dimethoxy(prop-2-en-1-yl)silane
CAS: 18147-35-8
Molecular Formula: C5H12O2Si
dimethoxy(prop-2-en-1-yl)silane - Names and Identifiers
| Name | dimethoxy(prop-2-en-1-yl)silane |
| Synonyms | ALLYLDIMETHOXYSILANE dimethoxy(prop-2-enyl)silicon dimethoxy(prop-2-en-1-yl)silane |
| CAS | 18147-35-8 |
| InChI | InChI=1/C5H12O2Si/c1-4-5-8(6-2)7-3/h4,8H,1,5H2,2-3H3 |
dimethoxy(prop-2-en-1-yl)silane - Physico-chemical Properties
| Molecular Formula | C5H12O2Si |
| Molar Mass | 132.23 |
| Boling Point | 107-9°C |
| Flash Point | 6.782°C |
| Vapor Presure | 71.186mmHg at 25°C |
| Specific Gravity | 0.877 |
| Sensitive | 7: reacts slowly with moisture/water |
| Refractive Index | 1.4450 |
dimethoxy(prop-2-en-1-yl)silane - Risk and Safety
| TSCA | No |
dimethoxy(prop-2-en-1-yl)silane - Introduction
dimethoxy(prop-2-en-1-yl)silane, chemical formula CH3SiH2OCH = CH2, expressed as VHMDS, is an organic silicon compound. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: colorless liquid
2. Density: about 0.880 g/cm
3. Boiling Point: about 126-130 ° C
4. Molecular weight: about 88.19g/mol
5. Flammable, volatile
6. Slow hydrolysis in air
Use:
1. VHMDS has the application value as a reagent, which can be used in deprotonation, nucleophilic reaction, dehydration and so on in organic synthesis reaction.
2. As a basic reagent, it can be used as a catalyst precursor and a base catalyst in a variety of synthesis reactions.
3. Used in the field of organic metal chemistry and organic synthesis.
Method:
dimethoxy(prop-2-en-1-yl)silane can be prepared by a Vilsmeier-Haack reaction. Please refer to the relevant organic synthesis literature for the specific preparation method.
Safety Information:
1. VHMDS need to avoid contact with oxygen during storage and use, because it is prone to spontaneous combustion.
2. Wear appropriate personal protective equipment, such as chemical protective gloves, goggles and protective clothing.
3. Do not pour VHMDS into fire or combustible materials, and avoid exposure to high temperature or open flame.
4. During use, it should be operated in a well-ventilated place to prevent vapor accumulation.
5. When handling or disposing of waste, please comply with local regulations and safety operation guidelines.
Nature:
1. Appearance: colorless liquid
2. Density: about 0.880 g/cm
3. Boiling Point: about 126-130 ° C
4. Molecular weight: about 88.19g/mol
5. Flammable, volatile
6. Slow hydrolysis in air
Use:
1. VHMDS has the application value as a reagent, which can be used in deprotonation, nucleophilic reaction, dehydration and so on in organic synthesis reaction.
2. As a basic reagent, it can be used as a catalyst precursor and a base catalyst in a variety of synthesis reactions.
3. Used in the field of organic metal chemistry and organic synthesis.
Method:
dimethoxy(prop-2-en-1-yl)silane can be prepared by a Vilsmeier-Haack reaction. Please refer to the relevant organic synthesis literature for the specific preparation method.
Safety Information:
1. VHMDS need to avoid contact with oxygen during storage and use, because it is prone to spontaneous combustion.
2. Wear appropriate personal protective equipment, such as chemical protective gloves, goggles and protective clothing.
3. Do not pour VHMDS into fire or combustible materials, and avoid exposure to high temperature or open flame.
4. During use, it should be operated in a well-ventilated place to prevent vapor accumulation.
5. When handling or disposing of waste, please comply with local regulations and safety operation guidelines.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: ALLYLDIMETHOXYSILANE Visit Supplier Webpage Request for quotation
CAS: 18147-35-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18147-35-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: ALLYLDIMETHOXYSILANE Visit Supplier Webpage Request for quotation
CAS: 18147-35-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18147-35-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History
dimethoxy(prop-2-en-1-yl)silane
[3-(trimethoxysilyl)propyl]urea
(hydroxymethyl)-cyclopentane
2167393-33-9
[3-(trimethoxysilyl)propyl]urea
(hydroxymethyl)-cyclopentane
2167393-33-9