maleicacidbis-(2-methylpropyl)ester
diisobutyl maleate
CAS: 14234-82-3
Molecular Formula: C12H20O4
maleicacidbis-(2-methylpropyl)ester - Names and Identifiers
| Name | diisobutyl maleate |
| Synonyms | DIBM DIISOBUTYL MALEATE diisobutyl maleate Maleic acid diisobutyl ester maleicacidbis-(2-methylpropyl)ester (Z)-2-Butenedioic acid diisobutyl ester bis(2-methylpropyl) (2Z)-but-2-enedioate (Z)-2-Butenedioic acid di(2-methylpropyl) ester 2-Butenedioicacid(2Z)-,bis(2-methylpropyl)ester 2-Butenedioic acid (2Z)-, bis(2-methylpropyl) ester 2-Butenedioic acid (2Z)-, 1,4-bis(2-methylpropyl) ester |
| CAS | 14234-82-3 |
| EINECS | 238-102-4 |
| InChI | InChI=1/C12H20O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3/b6-5- |
maleicacidbis-(2-methylpropyl)ester - Physico-chemical Properties
| Molecular Formula | C12H20O4 |
| Molar Mass | 228.28 |
| Density | 1.001g/cm3 at 25℃ |
| Boling Point | 246.19℃ at 101.325kPa |
| Flash Point | 129.8°C |
| Vapor Presure | 5.5Pa at 20℃ |
| Refractive Index | 1.449 |
maleicacidbis-(2-methylpropyl)ester - Reference Information
| LogP | 4.01 at 25℃ and pH7 |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |
Last Update：2024-04-09 20:49:11
