o-Hydroxy-N-phenylbenzylamine
N-(o-Hydroxybenzyl)aniline
CAS: 3526-45-2
Molecular Formula: C13H13NO
o-Hydroxy-N-phenylbenzylamine - Names and Identifiers
| Name | N-(o-Hydroxybenzyl)aniline |
| Synonyms | TIMTEC-BB SBB007834 2-(Anilinomethyl)phenol N-(o-Hydroxybenzyl)aniline 2-Hydroxybenzylphenylamine N-(2-Hydroxybenzyl)aniline N-(O-HYDROXY BENZYL)ANILINE o-Hydroxy-N-phenylbenzylamine 2-[(PHENYLAMINO)METHYL]PHENOL N-Phenyl-2-hydroxybenzenemethanamine |
| CAS | 3526-45-2 |
| InChI | InChI=1/C13H13NO/c15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12/h1-9,14-15H,10H2 |
o-Hydroxy-N-phenylbenzylamine - Physico-chemical Properties
| Molecular Formula | C13H13NO |
| Molar Mass | 199.25 |
| Density | 1.185g/cm3 |
| Boling Point | 359.5°C at 760 mmHg |
| Flash Point | 151.6°C |
| Vapor Presure | 1.14E-05mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.662 |
o-Hydroxy-N-phenylbenzylamine - Risk and Safety
| Hazard Class | IRRITANT |
o-Hydroxy-N-phenylbenzylamine - Upstream Downstream Industry
| Downstream Products | 3-PHENYL-3,4-DIHYDRO-2H-BENZO[E][1,3]OXAZINE |
o-Hydroxy-N-phenylbenzylamine - Introduction
N-(o-Hydroxybenzyl)aniline, also known as N-(o-hydroxybenzyl) aniline, is an organic compound. Its chemical formula is C13H13NO and its relative molecular mass is 199.25g/mol.
The compound has the following properties:
1. Appearance: colorless to light yellow crystal
2. melting point: about 61-63 ℃
3. Boiling point: about 332 ℃
4. Solubility: Dissolved in alcohol, ether and organic solvent, insoluble in water
5. pH: about 5.5-6.5
The main uses of N-(o-Hydroxybenzyl)aniline include:
1. chemical reagents: used as intermediates and catalysts in organic synthesis.
2. polymer compound: as a monomer of polymer, used for synthesis of polysulfoxide, polyether, polyurethane, etc.
3. Dyes: can be used as precursors of organic dyes.
4. Preservative: Due to its antibacterial properties, it can be used in the formulation of preservatives.
N-(o-Hydroxybenzyl)aniline preparation method:
At present, the commonly used preparation method is obtained by reacting aniline with resorcinol. The specific step is that aniline is first subjected to a condensation reaction with an acid to generate an iminium salt, and then a reduction reaction is performed to form an N-(o-Hydroxybenzyl)aniline.
The compound has limited safety information. During handling and operation, the following safety measures should be paid attention:
1. avoid contact with skin and eyes, such as accidental contact, should immediately rinse with plenty of water.
2. During operation, a well-ventilated laboratory environment should be maintained to avoid inhalation of gas or steam.
3. Proper laboratory procedures should be followed and appropriate protective equipment, such as lab gloves and goggles, should be worn.
4. During storage, the compound should be kept in a sealed container, away from heat and fire sources.
However, as a chemical, any operation needs to be cautious and evaluated and controlled according to specific circumstances and local regulations. If you have further questions or need detailed information, please consult a professional or relevant safety information.
The compound has the following properties:
1. Appearance: colorless to light yellow crystal
2. melting point: about 61-63 ℃
3. Boiling point: about 332 ℃
4. Solubility: Dissolved in alcohol, ether and organic solvent, insoluble in water
5. pH: about 5.5-6.5
The main uses of N-(o-Hydroxybenzyl)aniline include:
1. chemical reagents: used as intermediates and catalysts in organic synthesis.
2. polymer compound: as a monomer of polymer, used for synthesis of polysulfoxide, polyether, polyurethane, etc.
3. Dyes: can be used as precursors of organic dyes.
4. Preservative: Due to its antibacterial properties, it can be used in the formulation of preservatives.
N-(o-Hydroxybenzyl)aniline preparation method:
At present, the commonly used preparation method is obtained by reacting aniline with resorcinol. The specific step is that aniline is first subjected to a condensation reaction with an acid to generate an iminium salt, and then a reduction reaction is performed to form an N-(o-Hydroxybenzyl)aniline.
The compound has limited safety information. During handling and operation, the following safety measures should be paid attention:
1. avoid contact with skin and eyes, such as accidental contact, should immediately rinse with plenty of water.
2. During operation, a well-ventilated laboratory environment should be maintained to avoid inhalation of gas or steam.
3. Proper laboratory procedures should be followed and appropriate protective equipment, such as lab gloves and goggles, should be worn.
4. During storage, the compound should be kept in a sealed container, away from heat and fire sources.
However, as a chemical, any operation needs to be cautious and evaluated and controlled according to specific circumstances and local regulations. If you have further questions or need detailed information, please consult a professional or relevant safety information.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 2-[(PHENYLAMINO)METHYL]PHENOL Visit Supplier Webpage Request for quotation
CAS: 3526-45-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 3526-45-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-[(PHENYLAMINO)METHYL]PHENOL Visit Supplier Webpage Request for quotation
CAS: 3526-45-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 3526-45-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History
Downstream Products for o-Hydroxy-N-phenylbenzylamine