Name | 2,2-dimethylbutan-1-ol |
Synonyms | 183296 NSC 35406 BRN 1731439 tert-Amylcarbinol 2,2-Dimethylbutanol 2,2-Dimethylbutan-1-ol 2,2-Dimethyl-1-butanol 2,2-dimethylbutan-1-ol 2,2-DIMETHYL-1-BUTANOL 1-Butanol, 2,2-dimethyl- 4-01-00-01726 (Beilstein Handbook Reference) 4-chloro-6-(methoxymethyl)-2-(pyridin-3-yl)pyrimidine |
CAS | 1185-33-7 |
EINECS | 214-681-9 |
InChI | InChI=1/C11H10ClN3O/c1-16-7-9-5-10(12)15-11(14-9)8-3-2-4-13-6-8/h2-6H,7H2,1H3 |
Molecular Formula | C6H14O |
Molar Mass | 102.17 |
Density | 0.8246 |
Melting Point | -48.42°C (estimate) |
Boling Point | 135.85°C |
Flash Point | 120.9°C |
Water Solubility | 7.543g/L(25 ºC) |
Vapor Presure | 0.00814mmHg at 25°C |
pKa | 15.20±0.10(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.4188 |
category | flammable liquid |
toxicity classification | poisoning |
acute toxicity | oral-rat LD50: 1900 mg/kg |
stimulation data | skin-rabbit 14 mg/24 hours mild |
explosive hazard characteristics | blastable when mixed with air |
flammability hazard characteristics | flammable; combustion produces stimulating smoke |
storage and transportation characteristics | warehouse ventilation and low temperature drying |
fire extinguishing agent | dry powder, foam, sand, water |