thiazole-5-carboxylic
thiazole-5-carboxylic acid
CAS: 14527-41-4
Molecular Formula: C4H3NO2S
thiazole-5-carboxylic - Names and Identifiers
| Name | thiazole-5-carboxylic acid |
| Synonyms | AKOS BB-9162 RARECHEM AL BE 1261 Thiazole-5-carboxylic 5-THIAZOLECARBOXYLIC ACID 1,3-thiazole-5-carboxylate Thiazole-5-carboxylic acid thiazole-5-carboxylic acid THIAZOLE-5-CARBOXYLIC ACID 1,3-Thiazole-5-carboxyic acid 1,3-THIAZOLE-5-CARBOXYLIC ACID 1,3-thiazole-5-carboxylic acid 2-(4-methylphenoxy)pyridine-3-carbaldehyde |
| CAS | 14527-41-4 |
| EINECS | 238-545-3 |
| InChI | InChI=1/C4H3NO2S/c6-4(7)3-1-5-2-8-3/h1-2H,(H,6,7)/p-1 |
thiazole-5-carboxylic - Physico-chemical Properties
| Molecular Formula | C4H3NO2S |
| Molar Mass | 129.14 |
| Density | 1.525±0.06 g/cm3(Predicted) |
| Melting Point | 190-198 |
| Boling Point | 107-108 °C(Press: 10 Torr) |
| Flash Point | 146.9°C |
| Vapor Presure | 0.000143mmHg at 25°C |
| Appearance | Crystalline powder |
| pKa | 3.07±0.10(Predicted) |
| Storage Condition | 2-8°C |
| MDL | MFCD03428539 |
thiazole-5-carboxylic - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |
thiazole-5-carboxylic - Introduction
thiazole-5-carboxylic acid is an organic compound with the molecular formula C4H3NO2S and its properties are as follows:
1. Appearance: thiazole-5-carboxylic acid is usually a white crystalline solid.
2. Solubility: thiazole-5-carboxylic acid is easily soluble in water and most organic solvents.
3. Chemical properties: thiazole-5-carboxylic acid has strong acidity, and can be esterification, etherification, acylation and other reactions.
The main uses of thiazole-5-carboxylic acid include:
1. Pharmaceutical field: thiazole-5-carboxylic acid is an important pharmaceutical intermediate, which can be used to synthesize a variety of drugs, such as thiazolone antiviral drugs, anti-tumor drugs and antipsychotic drugs.
2. Agriculture: thiazole-5-carboxylic acid can be used to synthesize a variety of pesticides, such as thiazolone insecticides, herbicides and plant growth regulators.
thiazole-5-carboxylic acid preparation method mainly has the following kinds:
1. Thiazoline oxidation method: thiazole and hydrogen peroxide are reacted in the presence of a catalyst to generate thiazole-5-formaldehyde, which is then subjected to oxidation to obtain thiazole-5-carboxylic acid.
2. Hydrazine ammonia oxidation method: hydrazine ammonia and thiazole react under alkaline conditions to generate thiazole-5-carboxylic acid.
The security information for thiazole-5-carboxylic acid is as follows:
1. thiazole-5-carboxylic acid has a stimulating effect on eyes, skin and respiratory tract, please pay attention to avoid direct contact.
2. When using or handling thiazole-5-carboxylic acid, please wear appropriate personal protective equipment, such as protective gloves, protective glasses and masks.
3. thiazole-5-carboxylic acid storage should avoid sun exposure, high temperature and fire.
4. If accidental contact with thiazole-5-carboxylic acid, please rinse immediately with plenty of water, and timely medical treatment.
1. Appearance: thiazole-5-carboxylic acid is usually a white crystalline solid.
2. Solubility: thiazole-5-carboxylic acid is easily soluble in water and most organic solvents.
3. Chemical properties: thiazole-5-carboxylic acid has strong acidity, and can be esterification, etherification, acylation and other reactions.
The main uses of thiazole-5-carboxylic acid include:
1. Pharmaceutical field: thiazole-5-carboxylic acid is an important pharmaceutical intermediate, which can be used to synthesize a variety of drugs, such as thiazolone antiviral drugs, anti-tumor drugs and antipsychotic drugs.
2. Agriculture: thiazole-5-carboxylic acid can be used to synthesize a variety of pesticides, such as thiazolone insecticides, herbicides and plant growth regulators.
thiazole-5-carboxylic acid preparation method mainly has the following kinds:
1. Thiazoline oxidation method: thiazole and hydrogen peroxide are reacted in the presence of a catalyst to generate thiazole-5-formaldehyde, which is then subjected to oxidation to obtain thiazole-5-carboxylic acid.
2. Hydrazine ammonia oxidation method: hydrazine ammonia and thiazole react under alkaline conditions to generate thiazole-5-carboxylic acid.
The security information for thiazole-5-carboxylic acid is as follows:
1. thiazole-5-carboxylic acid has a stimulating effect on eyes, skin and respiratory tract, please pay attention to avoid direct contact.
2. When using or handling thiazole-5-carboxylic acid, please wear appropriate personal protective equipment, such as protective gloves, protective glasses and masks.
3. thiazole-5-carboxylic acid storage should avoid sun exposure, high temperature and fire.
4. If accidental contact with thiazole-5-carboxylic acid, please rinse immediately with plenty of water, and timely medical treatment.
Last Update：2024-04-09 18:58:34
Supplier List
Product Name: Thiazole-5-carboxylic acid Visit Supplier Webpage Request for quotation
CAS: 14527-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 14527-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Thiazole-5-carboxylic acid Visit Supplier Webpage Request for quotation
CAS: 14527-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 14527-41-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History