| Supplier Name | |
| Tel | 0086-512-63009836 |
| Mobile | |
| linda@struchem.com | |
| Website | http://www.struchem.com |
| Product Name | Ethyl Azidoacetate |
| Synonyms | ETHYLAZIDACETATE ETHYL AZIDOACETATE Ethyl Azidoacetate azido-aceticaciethylester AZIDOACETIC-ACID-ETHYL-ESTER Azidoacetic acid ethyl ester ETHYL 2-(1H-TRIAZIRIN-1-YL)ACETATE |
| CAS | 637-81-0 |
| EINECS | 211-301-3 |
| Chemical Formula | C4H7N3O2 |
| Molecular Weight | 129.12 |
| inchi | InChI=1/C4H8N3O2/c1-2-9-4(8)3-6-7-5/h5H,2-3H2,1H3/q+1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |