| Supplier Name | |
| Tel | 18927339850 |
| Mobile | 18927339850 |
| sales4@rafflespt.com | |
| Website | http://http://www.rafflespt.com |
| Product Name | methyl 6-methylnicotinate |
| Synonyms | LABOTEST-BB LT00847843 Methyl-6-methylnictinate METHYL 6-METHYLNICOTINATE 5-CARBOMETHOXY-2-PICOLINE Methyl-6-methylnicotinate methyl 6-methylnicotinate methyl 6-methyl nicotinate |
| CAS | 5470-70-2 |
| EINECS | 1308068-626-2 |
| Chemical Formula | C8H9NO2 |
| Molecular Weight | 151.16 |
| inchi | InChI=1/C8H9NO2/c1-6-3-4-7(5-9-6)8(10)11-2/h3-5H,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |