| Supplier Name | |
| Tel | 18927339850 |
| Mobile | 18927339850 |
| sales4@rafflespt.com | |
| Website | http://http://www.rafflespt.com |
| Product Name | 5'-Chloro-2'-hydoxy-3'-nitro-(1,1'-biphenyl)-3-Carboxylic acid |
| Synonyms | Eltrombopag int1 Eltrombopag Impurity 15 Eltrombopag Impurity 39 3-(5-chloro-2-hydroxy-3-nitrophenyl)benzoic acid 5'-Chloro-2'-hydroxy-3'-nitrobiphenyl-3-carboxylic acid 5-Chloro-2-hydroxy-3-nitro-(1,1-biphenyl)-3-carboxylic acid |
| CAS | 376592-58-4 |
| EINECS | 1592732-453-0 |
| Chemical Formula | C13H8ClNO5 |
| Molecular Weight | 293.66 |
| inchi | InChI=1S/C13H8ClNO5/c14-9-5-10(12(16)11(6-9)15(19)20)7-2-1-3-8(4-7)13(17)18/h1-6,16H,(H,17,18) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |