| Supplier Name | |
| Tel | 0519-82116250 |
| Mobile | 13775159780；13961176135 |
| sales@chengenchem.com | |
| Website | http://http://www.chengenchem.com/ |
| Product Name | Ethyl phenylacetate |
| Synonyms | Ethyl phenacetate Ethyl alpha-toluate Ethyl phenylacetate ethyl2-phenylacetate Ethyl benzeneacetate Phenyl Ethyl Acetate ethyl 2-phenylacetate |
| CAS | 101-97-3 |
| EINECS | 202-993-8 |
| Chemical Formula | C10H12O2 |
| Molecular Weight | 164.2 |
| inchi | InChI=1/C10H12O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |