| Supplier Name | |
| Tel | 0519-82116250 |
| Mobile | 13775159780；13961176135 |
| sales@chengenchem.com | |
| Website | http://http://www.chengenchem.com/ |
| Product Name | Prop-1-ene-1,3-sultone |
| Synonyms | 1,3-Propene sultone 1-Propene1,3-Sultone Prop-1-ene-1,3-sulto Prop-1-ene-1,3-sultone 5H-oxathiole 2,2-dioxide 5H-1,2-Oxathiole 2,2-dioxide 5H-1,2-Oxathiole, 2,2-dioxide |
| CAS | 21806-61-1 |
| EINECS | 606-834-7 |
| Chemical Formula | C3H4O3S |
| Molecular Weight | 120.13 |
| inchi | InChI=1/C3H4O3S/c4-7(5)3-1-2-6-7/h1,3H,2H2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |